
CAS 1466514-77-1
:Azetidine, 3-fluoro-3-(fluoromethyl)-
Description:
Azetidine, 3-fluoro-3-(fluoromethyl)- is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of fluorine substituents at the 3-position and the fluoromethyl group enhances its reactivity and influences its physical and chemical properties. This compound is typically colorless to pale yellow in appearance and may exhibit a distinct odor. It is soluble in organic solvents, and its reactivity can be attributed to the electronegative fluorine atoms, which can participate in various chemical reactions, including nucleophilic substitutions and additions. Azetidine derivatives are of interest in medicinal chemistry due to their potential biological activities, including antimicrobial and antiviral properties. Safety data should be consulted, as fluorinated compounds can pose specific health risks, including toxicity and environmental concerns. Overall, the unique structure and substituents of Azetidine, 3-fluoro-3-(fluoromethyl)- make it a compound of interest in both research and industrial applications.
Formula:C4H7F2N
InChI:InChI=1S/C4H7F2N/c5-1-4(6)2-7-3-4/h7H,1-3H2
InChI key:InChIKey=KBGBGVPRIMCNDI-UHFFFAOYSA-N
SMILES:C(F)C1(F)CNC1
Synonyms:- 3-Fluoro-3-(fluoromethyl)azetidine
- Azetidine, 3-fluoro-3-(fluoromethyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery