CAS 146670-40-8
:4-[2-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-dioxolan-2-yl]benzoic acid
Description:
4-[2-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-dioxolan-2-yl]benzoic acid, with CAS number 146670-40-8, is an organic compound characterized by its complex structure that includes a benzoic acid moiety and a dioxolane ring. This compound features a tetramethyl-substituted tetrahydronaphthalene group, which contributes to its hydrophobic characteristics and potential applications in organic synthesis and materials science. The presence of the dioxolane ring suggests potential reactivity and stability under certain conditions, making it of interest in various chemical reactions. Its unique structure may also impart specific physical properties, such as solubility and melting point, which are essential for its application in pharmaceuticals or as a chemical intermediate. The compound's molecular interactions, including hydrogen bonding due to the carboxylic acid group, can influence its behavior in biological systems or in polymer formulations. Overall, this compound exemplifies the diversity of organic chemistry and the potential for novel applications in various fields.
Formula:C24H28O4
InChI:InChI=1/C24H28O4/c1-22(2)11-12-23(3,4)20-15-18(9-10-19(20)22)24(27-13-14-28-24)17-7-5-16(6-8-17)21(25)26/h5-10,15H,11-14H2,1-4H3,(H,25,26)
SMILES:CC1(C)CCC(C)(C)c2cc(ccc12)C1(c2ccc(cc2)C(=O)O)OCCO1
Synonyms:- Benzoic acid, 4-[2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1,3-dioxolan-2-yl]-
- 4-[2-(5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-dioxolan-2-yl]benzoic acid
- 4-[2-(5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1,3-dioxolan-2-yl]-benzoicacid
- BMS649
- BMS 188649
- SR 11237
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzoic acid, 4-[2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1,3-dioxolan-2-yl]-
CAS:Formula:C24H28O4Purity:99%Molecular weight:380.4767SR11237
CAS:SR11237 is an advanced compound designed as a selective antagonist, which is synthesized through proprietary chemical processes. This product functions by specifically binding to a target receptor to inhibit its activity, thereby modulating the signaling pathways involved. SR11237 is primarily used in research to study receptor-mediated mechanisms and interactions within biological systems, providing insights into cellular processes and potential therapeutic targets.Formula:C24H28O4Purity:Min. 95%Molecular weight:380.48 g/molSR11237
CAS:SR11237 is a Pan retinoid X receptor (RXR) agonist.Formula:C24H28O4Purity:98.79%Color and Shape:SolidMolecular weight:380.48Ref: TM-T23383
1mg66.00€2mg82.00€5mg99.00€10mg173.00€25mg371.00€50mg640.00€100mg888.00€200mg1,198.00€1mL*10mM (DMSO)105.00€




