CAS 146698-96-6
:7-O-Ethyldaidzein
Description:
7-O-Ethyldaidzein is a synthetic derivative of daidzein, a naturally occurring isoflavone primarily found in soybeans and other legumes. This compound features an ethyl group attached to the hydroxyl group at the 7-position of the daidzein structure, which may influence its biological activity and solubility. Like other isoflavones, 7-O-ethyldaidzein is known for its potential phytoestrogenic properties, which can mimic estrogen in the body, and may exhibit antioxidant activity. Its chemical structure allows it to interact with various biological pathways, potentially offering health benefits such as anti-inflammatory effects and modulation of hormonal activity. The compound is of interest in pharmacological research, particularly in the context of hormone-related conditions and cancer. However, detailed studies on its specific biological effects, pharmacokinetics, and safety profile are necessary to fully understand its potential applications in medicine and nutrition. As with many synthetic compounds, the synthesis and characterization of 7-O-ethyldaidzein require careful consideration of its purity and stability for research and therapeutic use.
Formula:C17H14O4
InChI:InChI=1/C17H14O4/c1-2-20-13-7-8-14-16(9-13)21-10-15(17(14)19)11-3-5-12(18)6-4-11/h3-10,18H,2H2,1H3
SMILES:CCOc1ccc2c(c1)occ(c1ccc(cc1)O)c2=O
Synonyms:- 4H-1-benzopyran-4-one, 7-ethoxy-3-(4-hydroxyphenyl)-
- 7-ethoxy-3-(4-hydroxyphenyl)-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4H-1-Benzopyran-4-one, 7-ethoxy-3-(4-hydroxyphenyl)-
CAS:Formula:C17H14O4Color and Shape:SolidMolecular weight:282.29077-O-Ethyldaidzein
CAS:<p>7-O-Ethyldaidzein is a synthetic flavonoid derivative, which is primarily sourced from modifications of the naturally occurring isoflavone daidzein. Daidzein itself is found in soy products and other legumes. Through a chemical process, 7-O-ethyl groups are introduced to enhance its biological activity.</p>Formula:C17H14O4Purity:Min. 95%Color and Shape:PowderMolecular weight:282.29 g/mol

