CAS 1467-86-3
:6-Methylbenzo[b]thiophene-2-carboxylic acid
Description:
6-Methylbenzo[b]thiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene ring system substituted with a methyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and the ability to participate in electrophilic substitution reactions. The presence of the carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, influencing its solubility in polar solvents. Additionally, the methyl substitution can affect the compound's reactivity and steric hindrance. This substance may be of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of pharmaceuticals or as a building block in organic chemistry. Its CAS number, 1467-86-3, allows for easy identification in chemical databases and literature. Overall, 6-Methylbenzo[b]thiophene-2-carboxylic acid is a versatile compound with distinct chemical properties that can be leveraged in various chemical applications.
Formula:C10H8O2S
InChI:InChI=1/C10H8O2S/c1-6-2-3-7-5-9(10(11)12)13-8(7)4-6/h2-5H,1H3,(H,11,12)
SMILES:Cc1ccc2cc(C(=O)O)sc2c1
Synonyms:- Benzo[b]thiophene-2-carboxylic acid, 6-methyl-
- T56 Bsj Cvq H1
- 6-Methyl-1-Benzothiophene-2-Carboxylic Acid
- 6-Methylbenzo[b]thiophene-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzo[b]thiophene-2-carboxylic acid, 6-methyl-
CAS:Formula:C10H8O2SPurity:98%Color and Shape:SolidMolecular weight:192.23436-Methylbenzo[b]thiophene-2-carboxylic acid
CAS:6-Methylbenzo[b]thiophene-2-carboxylic acidFormula:C10H8O2SPurity:99%Color and Shape: powderMolecular weight:192.23g/mol6-Methylbenzo[b]thiophene-2-carboxylic acid
CAS:Formula:C10H8O2SPurity:98%Color and Shape:SolidMolecular weight:192.236-Methylbenzo[b]thiophene-2-carboxylic acid
CAS:Mebendazole is a benzimidazole anthelmintic drug that inhibits the growth of worms by binding to the benzimidazole-sensitive sites on the worm's nervous system. Mebendazole has been shown to be a potent and selective antagonist at the benzimidazole-sensitive site of the GABA receptor. This activity has been confirmed in vitro and in animal models, where it blocked convulsions induced by pentylenetetrazol. Mebendazole is also orally active, but modifications are needed to optimize its oral bioavailability and dosing. Mebendazole has been shown to have significant activity against some human parasites, including Entamoeba histolytica, Trichuris trichiura, and Giardia lamblia. In vivo studies have shown that mebendazole is well tolerated in humans when taken orally.Formula:C10H8O2SPurity:Min. 95%Molecular weight:192.24 g/mol



