CAS 14670-95-2

3-BROMO-5-METHYLADAMANTANE-1-CARBOXYLIC ACID

Description:

3-Bromo-5-methyladamantane-1-carboxylic acid is a chemical compound characterized by its adamantane structure, which is a polycyclic hydrocarbon known for its stability and unique three-dimensional shape. The presence of a bromine atom at the 3-position and a methyl group at the 5-position of the adamantane framework contributes to its distinct reactivity and physical properties. As a carboxylic acid, it features a carboxyl functional group (-COOH), which imparts acidic characteristics and allows for hydrogen bonding, influencing its solubility in polar solvents. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its molecular interactions can be influenced by the bromine substituent, which can affect lipophilicity and reactivity. Overall, 3-bromo-5-methyladamantane-1-carboxylic acid is notable for its unique structural attributes and potential applications in various chemical and pharmaceutical contexts.

Formula: C₁₂H₁₇BrO₂

InChI: InChI=1/C12H17BrO2/c1-10-2-8-3-11(5-10,9(14)15)7-12(13,4-8)6-10/h8H,2-7H2,1H3,(H,14,15)

SMILES: CC12CC3CC(C1)(CC(C3)(C2)Br)C(=O)O

Synonyms:

• Tricyclo[3.3.1.1~3,7~]Decane-1-Carboxylic Acid, 3-Bromo-5-Methyl-
• 3-Bromo-5-Methyltricyclo[3.3.1.1~3,7~]Decane-1-Carboxylic Acid
• 3-BROMO-5-METHYLADAMANTANE-1-CARBOXYLIC ACID

Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 3-bromo-5-methyl-

CAS: 14670-95-2

Formula: C₁₂H₁₇BrO₂

Molecular weight: 273.1662

Ref: IN-DA001E94

3-Bromo-5-methyladamantane-1-carboxylic acid

CAS: 14670-95-2

3-Bromo-5-methyladamantane-1-carboxylic acid

Purity: ≥95%

Molecular weight: 273.16618g/mol

Ref: 54-OR016440