CAS 146747-65-1: benzyl 7-oxo-9-azabicyclo[3.3.1]nonane-9-carboxylate

Description: Benzyl 7-oxo-9-azabicyclo[3.3.1]nonane-9-carboxylate is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring system, contributing to its classification as an azabicyclic compound. The presence of a carbonyl group (7-oxo) and a carboxylate moiety indicates potential reactivity and functional versatility, making it of interest in various synthetic applications. The benzyl group enhances its lipophilicity, potentially influencing its solubility and biological activity. This compound may exhibit properties typical of bicyclic amines, such as being a potential ligand in medicinal chemistry or serving as an intermediate in organic synthesis. Its unique structure may also impart specific pharmacological properties, making it a candidate for further investigation in drug development. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH, temperature, and the presence of solvents or catalysts.

Formula: C₁₆H₁₉NO₃

InChI: InChI=1/C16H19NO3/c18-15-9-13-7-4-8-14(10-15)17(13)16(19)20-11-12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-11H2

Synonyms:

• Benzyl 3-oxo-9-azabicyclo[3.3.1]nonane-9-carboxylate

N-Cbz-9-Azabicyclo[3.3.1]nonan-3-one

CAS: 146747-65-1

• Formula: C₁₆H₁₉NO₃
• Purity: 97%
• Molecular weight: 273.327

N-Cbz-9-azabicyclo[3.3.1]nonan-3-one

CAS: 146747-65-1

Versatile small molecule scaffold

• Formula: C₁₆H₁₉NO₃
• Purity: Min. 95%
• Molecular weight: 273.33 g/mol