CymitQuimica logo

CAS 14675-99-1

:

TERT-BUTOXYCARBONYLAMINO-NAPHTHALEN-1-YL-ACETIC ACID

Description:
Tert-butyloxycarbonylamino-naphthalen-1-yl-acetic acid, commonly referred to by its IUPAC name, is an organic compound characterized by the presence of a naphthalene ring, an acetic acid moiety, and a tert-butyloxycarbonyl (Boc) protecting group. This compound is typically used in organic synthesis, particularly in peptide synthesis, where the Boc group serves as a temporary protective group for amines. The naphthalene structure contributes to its hydrophobic characteristics, while the acetic acid component introduces a polar functional group, enhancing its solubility in polar solvents. The presence of the Boc group allows for selective deprotection under mild acidic conditions, facilitating further chemical transformations. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability, reactivity, and solubility properties are influenced by the functional groups present, making it a versatile intermediate in synthetic organic chemistry. As with all chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C17H19NO4
InChI:InChI=1S/C17H19NO4/c1-17(2,3)22-16(21)18-14(15(19)20)13-10-6-8-11-7-4-5-9-12(11)13/h4-10,14H,1-3H3,(H,18,21)(H,19,20)
InChI key:HRBQDQOOFCWHTR-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC(C1=CC=CC2=CC=CC=C21)C(=O)O
Found 3 products.