CAS 146781-28-4
:4-(Ethoxymethyl)benzoic acid
Description:
4-(Ethoxymethyl)benzoic acid is an organic compound characterized by its benzoic acid structure with an ethoxymethyl substituent at the para position. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the ethyl group. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its ethoxymethyl group can enhance lipophilicity, potentially influencing its biological activity and interactions. This compound may be utilized in pharmaceutical applications, particularly in drug design, where modifications to the benzoic acid framework can affect pharmacokinetics and efficacy. Additionally, it may serve as an intermediate in organic synthesis, contributing to the development of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H12O3
InChI:InChI=1S/C10H12O3/c1-2-13-7-8-3-5-9(6-4-8)10(11)12/h3-6H,2,7H2,1H3,(H,11,12)
InChI key:InChIKey=XSNKLGMYKSJLHQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(COCC)C=C1
Synonyms:- NSC 210358
- Benzoic acid, 4-(ethoxymethyl)-
- 4-(Ethoxymethyl)benzoic acid
- 4-Ethoxymethylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzoic acid, 4-(ethoxymethyl)-
CAS:Formula:C10H12O3Purity:95%Color and Shape:SolidMolecular weight:180.20054-(Ethoxymethyl)benzoic acid
CAS:4-(Ethoxymethyl)benzoic acid is a versatile building block that is used as a reagent in the manufacture of pharmaceuticals, pesticides, and other chemicals. It can be used to make various analogues of 4-phenylbutyric acid. This product is also useful for the synthesis of complex compounds such as 4-hydroxycoumarin and 3-phenylpropanoic acid. 4-(Ethoxymethyl)benzoic acid has been shown to be a potent inhibitor of protein kinase C (PKC) and may have anti-inflammatory properties.
Formula:C10H12O3Purity:Min. 95%Color and Shape:PowderMolecular weight:180.2 g/mol


