CAS 146794-84-5

Methanone, [2-[[8-(dimethylamino)octyl]thio]-6-(1-methylethyl)-3-pyridinyl]-2-thienyl-, ethanedioate (1:1)

Description:

Methanone, specifically the compound with the name "2-[[8-(dimethylamino)octyl]thio]-6-(1-methylethyl)-3-pyridinyl]-2-thienyl-, ethanedioate (1:1)" and CAS number 146794-84-5, is a complex organic molecule characterized by its unique structural features. It contains a thienyl group and a pyridinyl moiety, which contribute to its potential biological activity. The presence of a dimethylamino group suggests that it may exhibit basic properties, while the octyl chain indicates hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. The ethanedioate component implies that the compound may form salts or complexes, enhancing its stability or bioavailability. Such compounds are often investigated for their pharmacological properties, including potential use as pharmaceuticals or agrochemicals. The intricate arrangement of functional groups within this molecule may lead to diverse reactivity and interactions, making it a subject of interest in medicinal chemistry and related fields. However, specific data on its biological activity, toxicity, and applications would require further empirical studies.

Formula: C₂₃H₃₄N₂OS₂·C₂H₂O₄

InChI: InChI=1S/C23H34N2OS2.C2H2O4/c1-18(2)20-14-13-19(22(26)21-12-11-17-27-21)23(24-20)28-16-10-8-6-5-7-9-15-25(3)4;3-1(4)2(5)6/h11-14,17-18H,5-10,15-16H2,1-4H3;(H,3,4)(H,5,6)

InChI key: InChIKey=UUSSHPPSOUAHHP-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(SCCCCCCCCN(C)C)N=C(C(C)C)C=C1)C2=CC=CS2.C(C(O)=O)(O)=O

Synonyms:

• Methanone, [2-[[8-(dimethylamino)octyl]thio]-6-(1-methylethyl)-3-pyridinyl]-2-thienyl-, ethanedioate (1:1)

Y-29794 Oxalate

CAS: 146794-84-5

Y-29794 Oxalate is a synthetic compound classified as a thromboxane receptor antagonist. It is derived from chemical synthesis, primarily targeting the TXA2 receptor pathway. The compound functions by inhibiting the binding and action of thromboxane A2, a potent vasoconstrictor and promoter of platelet aggregation, effectively reducing thromboxane-mediated physiological responses.

Formula: C₂₅H₃₆N₂O₅S₂

Purity: Min. 95%

Molecular weight: 508.69 g/mol

Ref: 3D-WFA79484

Y-29794 oxalate

CAS: 146794-84-5

Inhibitor of prolyl endopeptidase

Formula: C₂₅H₃₆N₂O₅S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 508.69

Ref: TM-T23541