CymitQuimica logo

CAS 14682-34-9

:

(-)-Aromadendrene

Description:
(-)-Aromadendrene is a naturally occurring sesquiterpene hydrocarbon characterized by its complex structure and distinctive aromatic properties. It is primarily found in various essential oils and plant extracts, contributing to their fragrance and potential therapeutic effects. The compound is known for its chiral nature, with the "(-)" designation indicating its specific stereochemistry, which can influence its biological activity and interactions. Aromadendrene typically exhibits a low boiling point and is relatively insoluble in water, making it more soluble in organic solvents. Its molecular formula reflects a composition that includes multiple carbon and hydrogen atoms, typical of terpenes. (-)-Aromadendrene has garnered interest in the fields of perfumery and natural product chemistry due to its pleasant aroma and potential applications in flavoring and fragrance industries. Additionally, ongoing research explores its possible roles in traditional medicine and its effects on human health, highlighting the importance of understanding its chemical properties and biological activities.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h10-14H,1,5-8H2,2-4H3/t10-,11+,12-,13-,14-/m0/s1
InChI key:InChIKey=ITYNGVSTWVVPIC-NDKCEZKHSA-N
SMILES:CC1(C)[C@@]2([C@@]3([C@@](C(=C)CC[C@@]21[H])(CC[C@@H]3C)[H])[H])[H]
Synonyms:
  • 1H-Cycloprop[e]azulene, decahydro-1,1,7-trimethyl-4-methylene-, (1aS,4aS,7S,7aS,7bR)-(-)-
  • 1H-Cycloprop[e]azulene, decahydro-1,1,7-trimethyl-4-methylene-, [1aS-(1aα,4aα,7α,7aβ,7bα)]-
  • 1H-Cycloprop[e]azulene, decahydro-1,1,7-trimethyl-4-methylene-, (1aS,4aS,7S,7aS,7bR)-
  • Aromadendrene, (-)-
  • (1aS,4aS,7S,7aS,7bR)-Decahydro-1,1,7-trimethyl-4-methylene-1H-cycloprop[e]azulene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.