CAS 146829-37-0

Z-3-(TRIBUTYLSTANNYL)-2-PROPEN-1-AMINE

Description:

Z-3-(Tributylstannyl)-2-propen-1-amine is an organotin compound characterized by the presence of a tributylstannyl group attached to a propenamine structure. This compound typically exhibits properties associated with organotin compounds, such as potential applications in organic synthesis and materials science. The tributylstannyl group enhances the reactivity of the propenamine, making it useful in various chemical reactions, including cross-coupling reactions and as a precursor in the synthesis of more complex molecules. The presence of the amine functional group suggests potential for nucleophilic reactivity, allowing for further derivatization. Additionally, the Z configuration indicates a specific geometric arrangement around the double bond, which can influence the compound's reactivity and interaction with other molecules. Safety and environmental considerations are important when handling organotin compounds, as they can exhibit toxicity and bioaccumulation potential. Overall, Z-3-(Tributylstannyl)-2-propen-1-amine serves as a valuable intermediate in synthetic chemistry, particularly in the development of novel materials and pharmaceuticals.

Formula: C₁₅H₃₃NSn

InChI: InChI=1/3C4H9.C3H6N.Sn/c3*1-3-4-2;1-2-3-4;/h3*1,3-4H2,2H3;1-2H,3-4H2;/rC15H33NSn/c1-4-7-12-17(13-8-5-2,14-9-6-3)15-10-11-16/h10,15H,4-9,11-14,16H2,1-3H3/b15-10-

SMILES: CCCC[Sn](CCCC)(CCCC)/C=C\CN

Synonyms:

• (2Z)-3-(tributylstannanyl)prop-2-en-1-amine
• Z-3-(TRIBUTYLSTANNYL)-2-PROPEN-1-AMINE

Z-3-(Tributylstannyl)-2-propen-1-amine

CAS: 146829-37-0

Formula: C₁₅H₃₃NSn

Color and Shape: Liquid

Molecular weight: 346.1302

Ref: IN-DA001ED8

Z-3-(Tributylstannyl)-2-propen-1-amine

Controlled Product

CAS: 146829-37-0

Applications Z-3-(Tributylstannyl)-2-propen-1-amine (cas# 146829-37-0) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₁₅H₃₃NSn

Color and Shape: Neat

Molecular weight: 346.14

Ref: TR-T773980

Z-3-(Tributylstannyl)-2-propen-1-amine

Controlled Product

CAS: 146829-37-0

Please enquire for more information about Z-3-(Tributylstannyl)-2-propen-1-amine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₅H₃₃NSn

Purity: Min. 95%

Molecular weight: 346.14 g/mol

Ref: 3D-FT28403