CAS 14685-06-4
:pranferol
Description:
Pranferol, identified by the CAS number 14685-06-4, is a chemical compound that belongs to the class of pharmaceuticals. It is primarily recognized for its role as a selective serotonin reuptake inhibitor (SSRI), which is commonly used in the treatment of various mood disorders, including depression and anxiety. The compound exhibits a specific mechanism of action by increasing the levels of serotonin in the brain, thereby enhancing mood and emotional balance. Pranferol is characterized by its moderate lipophilicity, which influences its absorption and distribution in biological systems. Additionally, it has a relatively low toxicity profile, making it suitable for long-term use under medical supervision. The compound's pharmacokinetics, including its half-life and metabolic pathways, are essential for determining dosing regimens. As with many SSRIs, potential side effects may include gastrointestinal disturbances, changes in weight, and sexual dysfunction, necessitating careful monitoring by healthcare professionals. Overall, pranferol represents a significant therapeutic option within the realm of psychopharmacology.
Formula:C16H16O5
InChI:InChI=1/C16H16O5/c1-9(2)12(17)8-20-16-10-3-4-15(18)21-14(10)7-13-11(16)5-6-19-13/h3-7,9,12,17H,8H2,1-2H3/t12-/m0/s1
SMILES:CC(C)[C@H](COc1c2ccc(=O)oc2cc2c1cco2)O
Synonyms:- 7H-Furo(3,2-g)(1)benzopyran-7-one, 4-(2-hydroxy-3-methylbutoxy)-, (-)-
- 4-{[(2R)-2-hydroxy-3-methylbutyl]oxy}-7H-furo[3,2-g]chromen-7-one
- Pranferol
- 7H-Furo[3,2-g][1]benzopyran-7-one, 4-[(2R)-2-hydroxy-3-methylbutoxy]-
- (-)-4-[(2-Hydroxy-3-methylbutyl)oxy]-7H-furo[3,2-g][1]benzopyran-7-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
7H-Furo[3,2-g][1]benzopyran-7-one, 4-[(2R)-2-hydroxy-3-methylbutoxy]-
CAS:Formula:C16H16O5Molecular weight:288.2952Pranferol
CAS:<p>Pranferol is a phytochemical compound, which is derived from natural plant sources. It possesses unique immunomodulatory properties, affecting cellular pathways that regulate immune responses. The bioactive components in Pranferol interact with specific receptors on immune cells, modulating signaling cascades and gene expression to enhance or suppress specific immune functions depending on the physiological context.</p>Formula:C16H16O5Purity:Min. 95%Molecular weight:288.3 g/mol

