CAS 14686-63-6
:4-Hydroxyxanthone
Description:
4-Hydroxyxanthone is an organic compound belonging to the xanthone family, characterized by its polycyclic aromatic structure. It features a hydroxyl group (-OH) at the 4-position of the xanthone skeleton, which contributes to its chemical reactivity and potential biological activity. This compound is typically a yellow to orange crystalline solid, exhibiting moderate solubility in organic solvents and limited solubility in water. 4-Hydroxyxanthone is known for its antioxidant properties and has been studied for its potential applications in pharmaceuticals, particularly in the development of anti-inflammatory and anticancer agents. Its structure allows for various chemical modifications, making it a versatile compound in synthetic organic chemistry. Additionally, it may exhibit fluorescence, which can be useful in analytical applications. As with many xanthones, the presence of the hydroxyl group enhances its ability to form hydrogen bonds, influencing its interactions in biological systems and materials science. Overall, 4-Hydroxyxanthone is a compound of interest in both research and industrial applications due to its unique properties and potential benefits.
Formula:C13H8O3
InChI:InChI=1S/C13H8O3/c14-10-6-3-5-9-12(15)8-4-1-2-7-11(8)16-13(9)10/h1-7,14H
InChI key:InChIKey=KBQFPPUAIJHDCO-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC=3C1=CC=CC3)=C(O)C=CC2
Synonyms:- 9H-Xanthen-9-one, 4-hydroxy-
- 4-Hydroxyxanthone
- 4-Hydroxyxanthen-9-one
- Xanthen-9-one, 4-hydroxy-
- 4-Hydroxy-9H-xanthen-9-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
9H-Xanthen-9-one, 4-hydroxy-
CAS:Formula:C13H8O3Purity:98.0%Color and Shape:SolidMolecular weight:212.20084-Hydroxyxanthone
CAS:4-Hydroxyxanthone is a natural product for research related to life sciences. The catalog number is TN5913 and the CAS number is 14686-63-6.Formula:C13H8O3Purity:98%Color and Shape:SolidMolecular weight:212.2044-Hydroxyxanthone
CAS:4-Hydroxyxanthone is an organic compound, specifically a xanthone derivative, which is a naturally occurring polyphenolic compound found in certain plant sources, including members of the Guttiferae family. This compound exhibits various biological activities due to its structural properties, which allow it to interact with multiple biological targets.
Formula:C13H8O3Purity:Min. 95%Molecular weight:212.2 g/mol



