CAS 14686-65-8: 1,5-Dihydroxy-9H-xanthen-9-one
Description:1,5-Dihydroxy-9H-xanthen-9-one, also known as fluorescein, is a synthetic organic compound characterized by its vibrant fluorescent properties. It belongs to the xanthene class of dyes and features a xanthene core with two hydroxyl groups at the 1 and 5 positions. This compound is typically a bright yellow-green solid that is soluble in water and organic solvents, making it useful in various applications, including biological staining and as a pH indicator. Its fluorescence is highly sensitive to environmental conditions, such as pH and the presence of metal ions, which can affect its emission properties. Additionally, 1,5-Dihydroxy-9H-xanthen-9-one is utilized in photodynamic therapy and as a tracer in biological and environmental studies due to its ability to absorb light and emit fluorescence. Safety considerations include potential skin and eye irritation, and it is advisable to handle it with appropriate precautions in laboratory settings.
Formula:C13H8O4
InChI:InChI=1S/C13H8O4/c14-8-4-2-6-10-11(8)12(16)7-3-1-5-9(15)13(7)17-10/h1-6,14-15H
InChI key:InChIKey=APIPFXZYOMIJQG-UHFFFAOYSA-N
SMILES:O=C1C=2C=CC=C(O)C2OC=3C=CC=C(O)C13
- Synonyms:
- Xanthen-9-one, 1,5-dihydroxy-
- 1,5-Dihydroxy-9H-xanthen-9-one
- 9H-Xanthen-9-one, 1,5-dihydroxy-
- 1,5-Dihydroxyxanthone

1,5-Dihydroxyxanthone
Ref: TM-TN2504
5mg | 1,718.00 € |

1,5-Dihydroxyxanthone
Ref: 3D-PAA68665
1mg | 531.00 € | ||
2mg | 817.00 € | ||
5mg | 1,184.00 € | ||
10mg | 1,776.00 € | ||
25mg | 3,460.00 € |