CAS 14686-88-5
:3-O-ACETYL-1,2:5,6-DI-O-ISOPROPYLIDENE-ALPHA-D-ERYTHRO-HEX-3-ENOFURANOSE
Description:
3-O-Acetyl-1,2:5,6-di-O-isopropylidene-alpha-D-erythro-hex-3-enofuranose is a complex organic compound characterized by its furanose structure, which is a five-membered ring containing oxygen. This substance features multiple functional groups, including an acetyl group and isopropylidene protecting groups, which are commonly used in carbohydrate chemistry to stabilize reactive hydroxyl groups. The presence of the hex-3-enofuranose moiety indicates that it has a double bond in the hexose chain, contributing to its reactivity and potential applications in organic synthesis. The compound is typically used in research settings, particularly in the study of carbohydrate derivatives and their transformations. Its molecular structure allows for various chemical reactions, making it a valuable intermediate in the synthesis of more complex molecules. As with many organic compounds, it should be handled with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C14H20O7
InChI:InChI=1/C14H20O7/c1-7(15)17-10-9(8-6-16-13(2,3)19-8)18-12-11(10)20-14(4,5)21-12/h8,11-12H,6H2,1-5H3/t8?,11?,12-/m1/s1
SMILES:CC(=O)OC1=C(C2COC(C)(C)O2)O[C@H]2C1OC(C)(C)O2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
α-D-erythro-Hex-3-enofuranose, 1,2:5,6-bis-O-(1-methylethylidene)-, 3-acetate
CAS:Formula:C14H20O7Color and Shape:SolidMolecular weight:300.30443-O-Acetyl-1,2:5,6-di-O-isopropylidene-α-D-erythro-Hex-3-enofuranose
CAS:3-O-Acetyl-1,2:5,6-di-O-isopropylidene-α-D-erythro-Hex-3-enofuranoseMolecular weight:300.3044g/mol3-O-Acetyl-1,2:5,6-di-O-isopropylidene-a-D-gulofur-3-enose
CAS:3-O-Acetyl-1,2:5,6-di-O-isopropylidene-a-D-gulofur-3-enose is a carbohydrate that belongs to the group of saccharides. It is a synthetic sugar that has been modified with fluorination and methylation. This compound has high purity and can be custom synthesized to meet your requirements. 3-O-Acetyl-1,2:5,6-di-O--isopropylidene--a--D--gulofur--3--enose is an important sugar in glycosylation reactions. It can react with proteins or peptides to form glycosidic bonds in a process called click chemistry.Formula:C14H20O7Purity:Min. 95%Molecular weight:300.31 g/mol



