CAS 14689-51-1

4-nitro-2-(trifluoromethyl)-1H-benzimidazole

Description:

4-Nitro-2-(trifluoromethyl)-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a nitro group and a trifluoromethyl group. The presence of the nitro group typically imparts strong electron-withdrawing properties, influencing the compound's reactivity and polarity. The trifluoromethyl group is known for enhancing lipophilicity and stability, making the compound potentially useful in various applications, including pharmaceuticals and agrochemicals. This compound may exhibit biological activity, which can be attributed to its structural features, and it is often studied for its potential as a drug candidate or as an intermediate in organic synthesis. Additionally, its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Overall, 4-nitro-2-(trifluoromethyl)-1H-benzimidazole represents a significant compound in the field of medicinal chemistry and materials science.

Formula: C₈H₄F₃N₃O₂

InChI: InChI=1/C8H4F3N3O2/c9-8(10,11)7-12-4-2-1-3-5(14(15)16)6(4)13-7/h1-3H,(H,12,13)

SMILES: c1cc2c(c(c1)N(=O)=O)[nH]c(C(F)(F)F)n2

2-(Trifluoromethyl)-4-nitro-1H-benzimidazole

CAS: 14689-51-1

2-(Trifluoromethyl)-4-nitro-1H-benzimidazole

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 231.13g/mol

Ref: 54-PC32932