CAS 146931-13-7

N-(2-(bis(4-fluorophenyl)methylthio)ethyl)-N-methyl-N-(2-phenyl)ethylamine

Description:

N-(2-(bis(4-fluorophenyl)methylthio)ethyl)-N-methyl-N-(2-phenyl)ethylamine, identified by its CAS number 146931-13-7, is a chemical compound that belongs to the class of organic amines. This substance features a complex molecular structure characterized by the presence of multiple aromatic rings, specifically fluorinated phenyl groups, which can influence its chemical reactivity and biological activity. The presence of the methylthio group suggests potential for nucleophilic substitution reactions, while the amine functionalities may participate in hydrogen bonding and other interactions. The fluorine atoms in the structure can enhance lipophilicity and alter the compound's pharmacokinetic properties. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific arrangement of substituents can significantly affect the compound's properties, including solubility, stability, and interaction with biological targets. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₂₅H₂₄F₅NS

InChI: InChI=1/C25H24F5NS/c1-31(14-13-18-3-2-4-21(17-18)25(28,29)30)15-16-32-24(19-5-9-22(26)10-6-19)20-7-11-23(27)12-8-20/h2-12,17,24H,13-16H2,1H3

SMILES: CN(CCc1cccc(c1)C(F)(F)F)CCSC(c1ccc(cc1)F)c1ccc(cc1)F

Synonyms:

• Vuf 4576
• Benzeneethanamine, N-(2-((bis(4-fluorophenyl)methyl)thio)ethyl)-N-methyl-3-(trifluoromethyl)-
• 2-{[bis(4-fluorophenyl)methyl]sulfanyl}-N-methyl-N-{2-[3-(trifluoromethyl)phenyl]ethyl}ethanamine

Benzeneethanamine, N-[2-[[bis(4-fluorophenyl)methyl]thio]ethyl]-N-methyl-3-(trifluoromethyl)-

CAS: 146931-13-7

Formula: C₂₅H₂₄F₅NS

Molecular weight: 465.5218

Ref: IN-DA001EFY