CAS 146939-27-7: 2H-Indol-2-one, 5-[2-[4-(1,2-benzisothiazol-3-yl)-1-piperazinyl]ethyl]-6-chloro-1,3-dihydro-
Description:2H-Indol-2-one, 5-[2-[4-(1,2-benzisothiazol-3-yl)-1-piperazinyl]ethyl]-6-chloro-1,3-dihydro- is a chemical compound characterized by its complex structure, which includes an indole core fused with a benzisothiazole moiety and a piperazine substituent. This compound typically exhibits properties associated with both indole and benzisothiazole derivatives, such as potential biological activity, including antimicrobial and antitumor effects. The presence of the chloro group may influence its reactivity and solubility in various solvents. The piperazine ring contributes to its pharmacological profile, often enhancing interactions with biological targets. As a synthetic organic compound, it may be utilized in medicinal chemistry for drug development, particularly in the search for novel therapeutic agents. Its specific characteristics, such as melting point, solubility, and spectral data, would be determined through experimental methods and may vary based on the conditions of synthesis and purification. Safety data and handling precautions should be referenced from material safety data sheets (MSDS) due to potential hazards associated with its chemical structure.
Formula:C21H21ClN4OS
InChI:InChI=1S/C21H21ClN4OS/c22-17-13-18-15(12-20(27)23-18)11-14(17)5-6-25-7-9-26(10-8-25)21-16-3-1-2-4-19(16)28-24-21/h1-4,11,13H,5-10,12H2,(H,23,27)
InChI key:InChIKey=MVWVFYHBGMAFLY-UHFFFAOYSA-N
SMILES:O=C1NC2=CC(Cl)=C(C=C2C1)CCN3CCN(C4=NSC=5C=CC=CC54)CC3
- Synonyms:
- 5-[2-[4-(1,2-Benzisothiazol-3-yl)-1-piperazinyl)ethyl]-6-chloro-1,3-dihydro-2H-indol-2-one
- 5-[2-[4-(1,2-Benzisothiazol-3-yl)-1-piperazinyl]ethyl]-6-chloro-2-indolinone
- 5-[2-[4-(Benzo[d]isothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one
- Cp 88059
- Geodon
- Zaprasidone
- Zeldox
- Ziprasidone
- 2H-Indol-2-one, 5-[2-[4-(1,2-benzisothiazol-3-yl)-1-piperazinyl]ethyl]-6-chloro-1,3-dihydro-
- -(2-(4-(1,2-Benzisothiazol-3-yl)-1-piperazinyl)ethyl)-6-chloro-1,3-dihydro-2H-indol-2-one
- See more synonyms
![2H-Indol-2-one, 5-[2-[4-(1,2-benzisothiazol-3-yl)-1-piperazinyl]ethyl]-6-chloro-1,3-dihydro-](https://static.cymitquimica.com/cas-image/406756-ziprasidone.png)
![2H-Indol-2-one, 5-[2-[4-(1,2-benzisothiazol-3-yl)-1-piperazinyl]ethyl]-6-chloro-1,3-dihydro-](https://static.cymitquimica.com/products/IN/thumb/DA001EFT.jpg)
