CAS 14697-50-8
:2,2′-Oxybis[4,4,6-trimethyl-1,3,2-dioxaborinane]
Description:
2,2′-Oxybis[4,4,6-trimethyl-1,3,2-dioxaborinane], with CAS number 14697-50-8, is a boron-containing compound characterized by its unique dioxaborinane structure. This substance features two dioxaborinane units linked by an oxygen atom, which contributes to its stability and reactivity. The presence of trimethyl groups enhances its steric bulk, influencing its solubility and interaction with other chemical species. Typically, compounds of this nature exhibit properties such as moderate thermal stability and potential reactivity in organic synthesis, particularly in the formation of boron-containing intermediates. They may also serve as ligands in coordination chemistry or as precursors in the synthesis of more complex boron compounds. Additionally, the dioxaborinane framework can facilitate various chemical transformations, making it a valuable compound in materials science and organic chemistry. Safety data should be consulted for handling, as boron compounds can have specific health and environmental considerations.
Formula:C6H16B2O6
InChI:InChI=1/C12H24B2O5/c1-9-7-11(3,4)17-13(15-9)19-14-16-10(2)8-12(5,6)18-14/h9-10H,7-8H2,1-6H3
InChI key:InChIKey=KUZYYSNLEIAJQJ-UHFFFAOYSA-N
SMILES:O(B1OC(C)(C)CC(C)O1)B2OC(C)(C)CC(C)O2
Synonyms:- Caswell No. 627
- Hexyleneglycol boron anhydride
- 2,4-Pentanediol, 2-methyl-, cyclic B,B:B',B'-diester with boric acid (H4-B2-O5) (8CI)
- Hexyleneglycol boron anhydride
- 4-01-00-02569 (Beilstein Handbook Reference)
- 2,2′-Oxybis[4,4,6-trimethyl-1,3,2-dioxaborinane]
- 1,3,2-Dioxaborinane, 2,2'-oxybis(4,4,6-trimethyl-
- EPA Pesticide Chemical Code 012402
- BRN 1712941
- Borester 33
- AI3-50502
- 2,2'-Oxybis(4,4,6-trimethyl-1,3,2-dioxaborinane)
- 1,3,2-Dioxaborinane, 2,2′-oxybis[4,4,6-trimethyl-
- Borester 33
- 2,4-Pentanediol, 2-methyl-, cyclic B,B:B′,B′-diester with boric acid (H4B2O5)
- HEXYLENEGLYCOL BIBORATE
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,2′-Oxybis[4,4,6-trimethyl-1,3,2-dioxaborinane]
CAS:Formula:C12H24B2O5Color and Shape:NeatMolecular weight:269.94
