
CAS 1469791-66-9
:Poly[[4,8-bis[5-(2-ethylhexyl)-2-thienyl]benzo[1,2-b:4,5-b′]dithiophene-2,6-diyl][2-[[(2-ethylhexyl)oxy]carbonyl]-3-fluorothieno[3,4-b]thiophenediyl]]
Description:
The chemical substance known as Poly[[4,8-bis[5-(2-ethylhexyl)-2-thienyl]benzo[1,2-b:4,5-b′]dithiophene-2,6-diyl][2-[[(2-ethylhexyl)oxy]carbonyl]-3-fluorothieno[3,4-b]thiophenediyl]]], with CAS number 1469791-66-9, is a conjugated polymer characterized by its complex structure that includes multiple thiophene units and dithiophene linkages. This polymer exhibits notable electronic properties, making it suitable for applications in organic electronics, such as organic photovoltaics and field-effect transistors. Its design incorporates long alkyl side chains, which enhance solubility and processability, while the presence of fluorine and carbonyl functionalities can improve stability and electronic performance. The polymer's optical properties are influenced by its conjugated backbone, allowing for tunable absorption and emission characteristics. Overall, this substance represents a class of materials that are of significant interest in the development of advanced organic electronic devices due to their favorable charge transport properties and potential for high efficiency in energy conversion applications.
Formula:(C49H57FO2S6)n
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
PTB7-Th (PCE10)
CAS:<p>Fisher Scientific - PTB7-Th (PCE10), Thermo Scientific Chemicals - 1469791-66-9</p>Formula:(C49H57FO2S6)nColor and Shape:Flake or threadlike, BlackPTB7-Th
CAS:<p>PTB7-Th is a molecule that has been synthesized by the reaction of 3,4,5-trichlorobenzoyl chloride and thiophene. PTB7-Th has a molecular weight of 308.6 g/mol and a melting point of 220°C. It exhibits strong absorption in the UV region (around 300 nm) and has high photostability with an optical band gap of 2.2 eV. The intermolecular hydrogen bonds between the carbonyl group and the metal surface enhance its chemical stability on the surface of metals such as silver, copper, and platinum. PTB7-Th is also thermally stable up to 400°C with a decomposition temperature of 600°C.</p>Formula:(C49H57FO2S6)nPurity:Min. 95%

