CAS 146998-51-8

2-[4-methyl-6-(methylamino)-1,3,5-triazin-2-yl]phenol

Description:

2-[4-methyl-6-(methylamino)-1,3,5-triazin-2-yl]phenol, with the CAS number 146998-51-8, is a chemical compound characterized by its triazine and phenolic structures. This compound features a triazine ring, which is a six-membered heterocyclic structure containing three nitrogen atoms, contributing to its potential reactivity and biological activity. The presence of a methylamino group enhances its solubility and may influence its interaction with biological systems. The phenolic part of the molecule provides hydroxyl functionality, which can participate in hydrogen bonding and contribute to the compound's overall polarity. This compound may exhibit various properties, including potential antimicrobial or herbicidal activity, making it of interest in agricultural and pharmaceutical applications. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₁H₁₂N₄O

InChI: InChI=1/C11H12N4O/c1-7-13-10(15-11(12-2)14-7)8-5-3-4-6-9(8)16/h3-6,16H,1-2H3,(H,12,13,14,15)

SMILES: Cc1nc(c2ccccc2O)nc(=NC)[nH]1

Synonyms:

• Phenol, 2-[4-methyl-6-(methylamino)-1,3,5-triazin-2-yl]-

2-[4-methyl-6-(methylamino)-1,3,5-triazin-2-yl]phenol

CAS: 146998-51-8

Formula: C₁₁H₁₂N₄O

Purity: 95.0%

Molecular weight: 216.244

Ref: 10-F314346