CAS 1470-38-8

2-(3,4-dimethoxyphenyl)-1H-indene-1,3(2H)-dione

Description:

2-(3,4-Dimethoxyphenyl)-1H-indene-1,3(2H)-dione, with the CAS number 1470-38-8, is an organic compound characterized by its indene structure fused with a diketone functionality. This compound features a phenyl group substituted with two methoxy groups at the 3 and 4 positions, contributing to its chemical reactivity and potential biological activity. The presence of the indene moiety imparts unique electronic properties, making it a subject of interest in various chemical and pharmaceutical applications. Typically, compounds of this nature exhibit moderate to high lipophilicity due to the aromatic systems, which can influence their solubility and interaction with biological membranes. Additionally, the methoxy substituents can enhance the compound's stability and alter its reactivity, potentially affecting its pharmacokinetic properties. Overall, this compound may be explored for its potential in medicinal chemistry, particularly in the development of new therapeutic agents or as a building block in organic synthesis.

Formula: C₁₇H₁₄O₄

InChI: InChI=1/C17H14O4/c1-20-13-8-7-10(9-14(13)21-2)15-16(18)11-5-3-4-6-12(11)17(15)19/h3-9,15H,1-2H3

SMILES: COc1ccc(cc1OC)C1C(=O)c2ccccc2C1=O

Synonyms:

• 1H-Indene-1,3(2H)-dione, 2-(3,4-dimethoxyphenyl)-
• Indane-1,3-dione, 2-(3,4-dimethoxyphenyl)-