CAS 1470-57-1
:2-Hydroxy-5-methylbenzophenone
Description:
2-Hydroxy-5-methylbenzophenone, also known by its CAS number 1470-57-1, is an organic compound that belongs to the class of benzophenones. It features a benzophenone structure with a hydroxyl group (-OH) and a methyl group (-CH3) positioned on the aromatic rings. This compound is typically a white to pale yellow crystalline solid and is known for its ability to absorb ultraviolet (UV) light, making it useful as a UV filter in various applications, including cosmetics, plastics, and coatings. Its chemical formula is C15H12O3, and it exhibits properties such as moderate solubility in organic solvents and limited solubility in water. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in various chemical reactions, including esterification and etherification. Additionally, 2-Hydroxy-5-methylbenzophenone is studied for its potential applications in photostabilizers and as an intermediate in organic synthesis. Safety data indicates that it should be handled with care, as with many organic compounds, due to potential health and environmental impacts.
Formula:C14H12O2
InChI:InChI=1S/C14H12O2/c1-10-7-8-13(15)12(9-10)14(16)11-5-3-2-4-6-11/h2-9,15H,1H3
InChI key:InChIKey=OQERFUGURPLBQH-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(O)C=CC(C)=C1)C2=CC=CC=C2
Synonyms:- (2-Hydroxy-5-Methylphenyl)(Phenyl)Methanone
- (2-Hydroxy-5-methylphenyl)phenylmethanone
- 2-Benzoyl-4-methylphenol
- 5-Methyl-2-hydroxybenzophenone
- Benzophenone, 2-hydroxy-5-methyl-
- Methanone, (2-hydroxy-5-methylphenyl)phenyl-
- NSC 296
- 2-Hydroxy-5-methylbenzophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Hydroxy-5-methylbenzophenone
CAS:Formula:C14H12O2Purity:>97.0%(GC)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:212.25Methanone, (2-hydroxy-5-methylphenyl)phenyl-
CAS:Formula:C14H12O2Purity:97%Color and Shape:SolidMolecular weight:212.24392-Hydroxy-5-methylbenzophenone
CAS:2-Hydroxy-5-methylbenzophenonePurity:99%Molecular weight:212.24388g/mol2-Hydroxy-5-methylbenzophenone
CAS:<p>2-Hydroxy-5-methylbenzophenone is an organic chemical compound that has a hydroxyl group and two phenyl groups. It is used in the synthesis of coumarin derivatives with UV absorption, which are used in the determination of the kinetic data of oxidative reactions. The reaction rate of 2-hydroxy-5-methylbenzophenone is constant and depends on the number of hydrogen atoms present in the molecule. It reacts with chloride ions to produce a kinetic product, water molecule, and kinetic chloride ion. The kinetic constant for this reaction is determined by measuring the rate at which it takes place under different concentrations of chloride ions.<br>2-Hydroxy-5-methylbenzophenone is also used as a structural probe to study the hydroxyl group and its reactivity with other functional groups, such as chlorine and water molecules. These studies have shown that it has a high reactivity with these functional groups, which results in an increase in uv</p>Formula:C14H12O2Purity:Min. 95%Color and Shape:PowderMolecular weight:212.24 g/mol




