CAS 147005-91-2

2-(chloromethyl)thieno[3,2-d]pyrimidin-4(3H)-one

Description:

2-(Chloromethyl)thieno[3,2-d]pyrimidin-4(3H)-one is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a thieno and a pyrimidinone moiety. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. It typically exhibits properties associated with heterocycles, such as solubility in polar organic solvents and moderate stability under standard conditions. The presence of the thieno and pyrimidinone rings contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also display specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Its CAS number, 147005-91-2, allows for precise referencing in chemical databases and literature. Overall, this compound represents a significant class of organic molecules with potential applications in various fields, including drug discovery and development.

Formula: C₇H₅ClN₂OS

InChI: InChI=1/C7H5ClN2OS/c8-3-5-9-4-1-2-12-6(4)7(11)10-5/h1-2H,3H2,(H,9,10,11)

SMILES: c1csc2c1nc(CCl)nc2O

Synonyms:

• 2-Chloromethyl-3H-thieno[3,2-d]pyrimidin-4-one
• thieno[3,2-d]pyrimidin-4(3H)-one, 2-(chloromethyl)-
• Thieno[3,2-D]Pyrimidin-4-Ol, 2-(Chloromethyl)-

Thieno[3,2-d]pyrimidin-4(3H)-one, 2-(chloromethyl)-

CAS: 147005-91-2

Formula: C₇H₅ClN₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 200.6454

Ref: IN-DA001EIX

2-(Chloromethyl)thieno[3,2-d]pyrimidin-4(3H)-one

CAS: 147005-91-2

2-(Chloromethyl)thieno[3,2-d]pyrimidin-4(3H)-one

Purity: 98%

Molecular weight: 200.65g/mol

Ref: 54-OR1026680

2-(chloromethyl)thieno[3,2-d]pyrimidin-4(3H)-one

CAS: 147005-91-2

Formula: C₇H₅ClN₂OS

Purity: 98%(HPLC);RG

Molecular weight: 200.64

Ref: 10-F311293