CAS 147027-04-1
:1,3-Oxathiolane-2-carboxylic acid, 5-hydroxy-, (2R,5R)-rel-
Description:
1,3-Oxathiolane-2-carboxylic acid, 5-hydroxy-, (2R,5R)-rel- is a chemical compound characterized by its unique oxathiolane ring structure, which incorporates sulfur and oxygen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of a hydroxyl group at the 5-position enhances its solubility in polar solvents and may influence its biological activity. The stereochemistry indicated by the (2R,5R) configuration suggests specific spatial arrangements of its atoms, which can significantly affect its interaction with biological systems and other chemical entities. This compound may be of interest in medicinal chemistry and pharmaceutical applications due to its structural features, which could impart specific pharmacological properties. Additionally, its CAS number, 147027-04-1, allows for precise identification and retrieval of information regarding its properties, synthesis, and potential uses in research and industry.
Formula:C4H6O4S
InChI:InChI=1/C4H6O4S/c5-2-1-9-4(8-2)3(6)7/h2,4-5H,1H2,(H,6,7)/t2-,4-/s2
InChI key:InChIKey=LOWHAEXKCMFUMV-RCEPREDVNA-N
SMILES:C(O)(=O)[C@H]1O[C@H](O)CS1
Synonyms:- 1,3-Oxathiolane-2-carboxylic acid, 5-hydroxy-, trans-
- 1,3-Oxathiolane-2-carboxylic acid, 5-hydroxy-, (2R,5R)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
rac-trans-5-Hydroxy-1,3-oxathiolane-2-carboxylic Acid
CAS:Controlled ProductStability Epimerize in solution
Applications 5-Hydroxy-1,3-oxathiolane-2-carboxylic Acid is used in the synthesis of potent antiviral agent (-)-2’-Deoxy-3’-thiacytidine and its enantiomer.
References Jin, H.L., et al.: J. Org. Chem., 60, 2621 (1995);Formula:C4H6O4SColor and Shape:NeatMolecular weight:150.15
