CAS 14704-41-7
:3,5-BIS(TRIFLUOROMETHYL)PYRAZOLE
Description:
3,5-Bis(trifluoromethyl)pyrazole is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of two trifluoromethyl groups (-CF3) at the 3 and 5 positions significantly influences its chemical properties, imparting high lipophilicity and stability. This compound is typically a white to off-white solid and is known for its low volatility and high thermal stability. The trifluoromethyl groups enhance its electron-withdrawing characteristics, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, 3,5-bis(trifluoromethyl)pyrazole exhibits potential biological activity, which has garnered interest in research for its applications in crop protection and medicinal chemistry. Its unique structure and properties make it a valuable compound in both industrial and research settings, particularly in the development of new chemical entities with specific functionalities. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.
Formula:BF4Ni
InChI:InChI=1/BF4.Ni/c2-1(3,4)5;/q-1;+2
SMILES:[B-](F)(F)(F)F.[Ni]
Synonyms:- Timtec-Bb Sbb006683
- 3,5-Di(Trifluoromethyl)Pyrazole
- 3,5-Bis(Trifluoromethyl)-1H-Pyrazole
- 3,3-Bis(trifluoromethyl)pyrazol
- 3,5-Bis(trifluoromethyl)pyrazole 97%
- 3,5-Bis(trifluoromethyl)pyrazole97%
- Borate(1-), Tetrafluoro-, Nickel(2+)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,5-Bis(trifluoromethyl)pyrazole
CAS:Formula:C5H2F6N2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:204.081H-Pyrazole, 3,5-bis(trifluoromethyl)-
CAS:Formula:C5H2F6N2Purity:98%Color and Shape:SolidMolecular weight:204.0732Ref: IN-DA001EKE
50gTo inquire100gTo inquire500gTo inquire100mg26.00€250mg30.00€1g48.00€5g125.00€10g169.00€25g347.00€3,5-Bis(trifluoromethyl)pyrazole
CAS:Formula:C5H2F6N2Purity:98%Color and Shape:SolidMolecular weight:204.0753,5-Bis(trifluoromethyl)pyrazole
CAS:3,5-Bis(trifluoromethyl)pyrazole is a pyrazole derivative that can be used in coordination chemistry. It has been shown to act as a ligand for the copper oxide ion channel. The binding of 3,5-bis(trifluoromethyl)pyrazole to the copper oxide ion channel leads to an increase in the amount of Ca2+ ions that enter the cell. This compound has also been shown to inhibit the activity of x-ray crystal structures and cation channels with nanomolar concentrations. These properties make 3,5-bis(trifluoromethyl)pyrazole an effective agent for treating various diseases like cancer, Alzheimer's disease, and epilepsy.Formula:C5H2F6N2Purity:Min. 95%Molecular weight:204.07 g/mol3,5-Bis(trifluoromethyl)-1H-pyrazole
CAS:3,5-Bis(trifluoromethyl)-1H-pyrazoleFormula:C5H2F6N2Purity:95%Color and Shape: yellow solidMolecular weight:204.07g/mol




