CAS 14705-63-6
:5,10,15,20-TETRAPHENYL-21H,23H-PORPHINE VANADIUM(IV) OXIDE
Description:
5,10,15,20-Tetraphenyl-21H,23H-porphine vanadium(IV) oxide, commonly referred to as vanadyl tetraphenylporphyrin, is a coordination compound featuring a vanadium center coordinated to a porphyrin ligand. This compound exhibits a deep color, typically purple or blue, due to the presence of the porphyrin ring, which is known for its ability to absorb visible light. The vanadium(IV) oxidation state imparts unique electronic properties, making it of interest in various applications, including catalysis and as a model for biological systems. The porphyrin structure contributes to its stability and solubility in organic solvents, while the phenyl substituents enhance its electronic characteristics. Additionally, this compound can participate in redox reactions, making it useful in studies related to electron transfer processes. Its potential applications extend to fields such as materials science, photochemistry, and bioinorganic chemistry, where it can serve as a catalyst or a probe for studying metal interactions in biological systems. Safety data should be consulted before handling, as with all chemical substances.
Formula:C44H28N4OV
InChI:InChI=1/C44H28N4.O.V/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;;/h1-28H;;/q-2;;+2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-;;/rC44H28N4OV/c49-50-47-37-25-26-38(47)43(31-17-9-3-10-18-31)35-23-24-36(46-35)44(32-19-11-4-12-20-32)40-28-27-39(48(40)50)42(30-15-7-2-8-16-30)34-22-21-33(45-34)41(37)29-13-5-1-6-14-29/h1-28H/b41-33-,41-37-,42-34-,42-39-,43-35-,43-38-,44-36-,44-40-
SMILES:c1ccc(cc1)C1=c2ccc(=C(c3ccccc3)C3=NC(=C(c4ccccc4)c4ccc(C(=C5C=CC1=N5)c1ccccc1)[n-]4)C=C3)[n-]2.O.V
Synonyms:- Oxo[5,10,15,20-Tetraphenylporphinato(2-)]Vanadium
- Protoporphyrin Ix V(Iv) Oxide
- Vanadyl(Ii)Mesotetraphenylporphine
- Vanadyl(Iv) Meso-Tetraphenylporphine
- Vanadyl (Iv) Tetraphenylporphine
- Vanadyl Meso-Tetraphenylporphine
- Vanadium (Iv) Oxide Meso-Tetraphenylporphine
- Vanadium (Iv)-Oxo-Tetraphenylporphyrine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Vanadium(IV) oxide meso-tetraphenylporphine
CAS:<p>It is used for research in catalysis. Thin films of VOTPP may be used in detecting methane gas. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar prod</p>Formula:C44H28N4OVMolecular weight:679.675,10,15,20-Tetraphenyl-21H,23H-porphine vanadium(IV) oxide
CAS:Formula:C44H30N4OVPurity:>97%(HPLC)Color and Shape:SolidMolecular weight:681.67675,10,15,20-Tetraphenyl-21H,23H-Porphinevanadium(IV) Oxide
CAS:5,10,15,20-Tetraphenyl-21H,23H-Porphinevanadium(IV) OxidePurity:97%Molecular weight:679.7g/molVanadyl meso-tetraphenylporphine (1-3% chlorin)
CAS:Formula:C44H28N4OVPurity:>95%Molecular weight:679.66Vanadyl Meso-Tetraphenylporphine
CAS:Controlled Product<p>Applications Vanadyl Meso-Tetraphenylporphine (1-3% Chlorin) (cas# 14705-63-6) is a useful research chemical.<br></p>Formula:C44H28N4OVColor and Shape:NeatMolecular weight:679.66Vanadyl meso-tetraphenylporphine
CAS:<p>Vanadyl meso-tetraphenylporphine</p>Formula:(C44H28N4)VOColor and Shape:purple xtl.Molecular weight:679.67





