
CAS 147059-71-0
:1,8-Naphthyridine-3-carboxylic acid, 7-(6-amino-3-azabicyclo[3.1.0]hex-3-yl)-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-, (1α,5α,6α)-
Description:
1,8-Naphthyridine-3-carboxylic acid, 7-(6-amino-3-azabicyclo[3.1.0]hex-3-yl)-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-, (1α,5α,6α)- is a complex organic compound characterized by its bicyclic structure and multiple functional groups. It features a naphthyridine core, which is a fused bicyclic aromatic compound known for its biological activity. The presence of a carboxylic acid group indicates potential for hydrogen bonding and reactivity, while the cyclopropyl and fluoro substituents contribute to its unique chemical properties and may influence its pharmacological profile. The compound also contains an amino group, which can participate in various interactions, enhancing its potential as a bioactive molecule. Its stereochemistry, indicated by the (1α,5α,6α) designation, suggests specific spatial arrangements that could affect its interaction with biological targets. Overall, this compound may exhibit significant interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural complexity and potential biological activities.
Formula:C17H17FN4O3
InChI:InChI=1/C17H17FN4O3/c18-12-3-8-14(23)11(17(24)25)6-22(7-1-2-7)15(8)20-16(12)21-4-9-10(5-21)13(9)19/h3,6-7,9-10,13H,1-2,4-5,19H2,(H,24,25)/t9-,10+,13+
InChI key:InChIKey=HPQJHUNCWWNOJL-IWIIMEHWNA-N
SMILES:O=C1C=2C(N(C=C1C(O)=O)C3CC3)=NC(=C(F)C2)N4C[C@]5([C@@](C4)([C@@H]5N)[H])[H]
Synonyms:- 1,8-Naphthyridine-3-carboxylic acid, 7-(6-amino-3-azabicyclo[3.1.0]hex-3-yl)-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-, (1α,5α,6α)-
- 3-Azabicyclo[3.1.0]hexane, 1,8-naphthyridine-3-carboxylic acid deriv.
- CP 99433
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CP 99433
CAS:<p>CP 99433: C-7 diazabicyclofluoroquinolone, broad-spectrum against Enterobacteriaceae, Gram-positive cocci, nonenteric Gram-negatives.</p>Formula:C17H17FN4O3Color and Shape:SolidMolecular weight:344.34
