CAS 147078-81-7
:2-Bromo-4-(4-chlorophenyl)-3-pyridinecarboxylic acid
Description:
2-Bromo-4-(4-chlorophenyl)-3-pyridinecarboxylic acid is an organic compound characterized by its complex structure, which includes a pyridine ring, a carboxylic acid functional group, and halogen substituents. The presence of the bromine and chlorine atoms contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound typically exhibits moderate solubility in organic solvents, while its carboxylic acid group can engage in hydrogen bonding, influencing its solubility in polar solvents. The molecular structure suggests potential biological activity, making it of interest in pharmaceutical research. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 2-Bromo-4-(4-chlorophenyl)-3-pyridinecarboxylic acid is a versatile compound with applications in organic synthesis and medicinal chemistry, reflecting the importance of halogenated pyridine derivatives in drug development and material science.
Formula:C12H7BrClNO2
InChI:InChI=1S/C12H7BrClNO2/c13-11-10(12(16)17)9(5-6-15-11)7-1-3-8(14)4-2-7/h1-6H,(H,16,17)
InChI key:InChIKey=PKBRYBJHIGRLEK-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CC=NC1Br)C2=CC=C(Cl)C=C2
Synonyms:- 3-Pyridinecarboxylic acid, 2-bromo-4-(4-chlorophenyl)-
- 2-Bromo-4-(4-chlorophenyl)-3-pyridinecarboxylic acid
- 2-Bromo-4-(4-chlorophenyl)nicotinic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.