CymitQuimica logo

CAS 147086-80-4

:

4H-Thieno[2,3-b]thiopyran-4-ol, 5,6-dihydro-6-methyl-, (4R-cis)-

Description:
4H-Thieno[2,3-b]thiopyran-4-ol, 5,6-dihydro-6-methyl-, (4R-cis)-, identified by CAS number 147086-80-4, is a heterocyclic organic compound featuring a fused thiophene and thiopyran structure. This compound exhibits a chiral center, which contributes to its stereochemistry, specifically the (4R-cis) configuration. It is characterized by the presence of a hydroxyl group (-OH) at the 4-position and a methyl group at the 6-position of the thiopyran ring. The compound's unique structure may impart specific chemical reactivity and biological activity, making it of interest in medicinal chemistry and material science. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, and could serve as a precursor for synthesizing more complex molecules. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C8H10OS2
InChI:InChI=1S/C8H10OS2/c1-5-4-7(9)6-2-3-10-8(6)11-5/h2-3,5,7,9H,4H2,1H3/t5-,7+/m0/s1
InChI key:InChIKey=RSJUYFIZTAZAEA-CAHLUQPWSA-N
SMILES:O[C@H]1C2=C(S[C@@H](C)C1)SC=C2
Synonyms:
  • (4R,6S)-5,6-Dihydro-4-hydroxy-6-methylthieno[2,3-b]thiopyran
  • 4H-Thieno[2,3-b]thiopyran-4-ol, 5,6-dihydro-6-methyl-, (4R-cis)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.