CAS 14714-22-8

Imidazo[1,2-b]pyridazine-3-carboxylic acid, 6-chloro-2-methyl-

Description:

Imidazo[1,2-b]pyridazine-3-carboxylic acid, 6-chloro-2-methyl- is a heterocyclic compound characterized by its fused imidazole and pyridazine rings, which contribute to its unique chemical properties. The presence of a carboxylic acid functional group enhances its acidity and potential for hydrogen bonding, while the chloro and methyl substituents introduce additional reactivity and steric effects. This compound is typically used in medicinal chemistry and research due to its potential biological activity, including antimicrobial and anti-inflammatory properties. Its structural features allow for various synthetic modifications, making it a versatile building block in drug development. The compound's solubility, stability, and reactivity can be influenced by the substituents on the ring system, which are critical for its interaction with biological targets. Overall, imidazo[1,2-b]pyridazine-3-carboxylic acid, 6-chloro-2-methyl- represents a significant class of compounds in pharmaceutical chemistry, with ongoing research into its applications and mechanisms of action.

Formula: C₈H₆ClN₃O₂

InChI: InChI=1/C8H6ClN3O2/c1-4-7(8(13)14)12-6(10-4)3-2-5(9)11-12/h2-3H,1H3,(H,13,14)

SMILES: Cc1c(C(=O)O)n2c(ccc(Cl)n2)n1

Synonyms:

• 2-Methyl-5-Chloro-Imidazo[1,2-B]Pyridazine 3-Carboxylic Acid

6-Chloro-2-methylimidazo[1,2-b]pyridazine-3-carboxylic acid

CAS: 14714-22-8

Formula: C₈H₆ClN₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 211.6051

Ref: IN-DA001ENQ

6-Chloro-2-methylimidazo[1,2-b]pyridazine-3-carboxylic acid

CAS: 14714-22-8

6-Chloro-2-methylimidazo[1,2-b]pyridazine-3-carboxylic acid

Purity: ≥95%

Molecular weight: 211.61g/mol

Ref: 54-OR111308

6-Chloro-2-methylimidazo[1,2-b]pyridazine-3-carboxylic acid

CAS: 14714-22-8

Formula: C₈H₆ClN₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 211.61

Ref: 10-F066589