CAS 14719-37-0
:tert-Butoxycarbonylamino-acetic acid ethyl ester
Description:
Tert-Butoxycarbonylamino-acetic acid ethyl ester, commonly referred to as Boc-Ala-OEt, is an organic compound characterized by its structure, which includes a tert-butoxycarbonyl (Boc) protecting group attached to an amino acid derivative, specifically alanine. This compound is typically used in peptide synthesis as a protecting group for the amino functionality, allowing for selective reactions without interfering with the amine. It is a colorless to pale yellow liquid or solid, depending on the specific conditions, and is soluble in organic solvents such as dichloromethane and ethyl acetate. The presence of the ethyl ester group enhances its lipophilicity, making it suitable for various organic reactions. Additionally, the Boc group can be easily removed under acidic conditions, facilitating the deprotection of the amino group when needed. Its stability under neutral and basic conditions makes it a valuable intermediate in organic synthesis and pharmaceutical applications. Safety precautions should be taken when handling this compound, as with many organic chemicals, due to potential irritant properties.
Formula:C9H17NO4
InChI:InChI=1/C9H17NO4/c1-5-13-7(11)6-10-8(12)14-9(2,3)4/h5-6H2,1-4H3,(H,10,12)
SMILES:CCOC(=O)CN=C(O)OC(C)(C)C
Synonyms:- Ethyl N-(tert-butoxycarbonyl)glycinate
- Glycine, N-[(1,1-dimethylethoxy)carbonyl]-, ethyl ester
- N-Boc-glycine Ethyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Boc-glycine ethyl ester, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H17NO4Purity:95%Molecular weight:203.24TERT-BUTOXYCARBONYLAMINO-ACETIC ACID ETHYL ESTER
CAS:Formula:C9H17NO4Purity:98%Color and Shape:LiquidMolecular weight:203.2356N-(tert-Butoxycarbonyl)glycine Ethyl Ester
CAS:Formula:C9H17NO4Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:203.24Ethyl [(tert-butoxycarbonyl)amino]acetate
CAS:Ethyl [(tert-butoxycarbonyl)amino]acetatePurity:≥95%Color and Shape:CrystalsMolecular weight:203.24g/mol




