CAS 14720-74-2
:2,2,4-Trimethylheptane
Description:
2,2,4-Trimethylheptane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. It has the molecular formula C11H24 and is known for its high octane rating, making it a valuable component in gasoline formulations. This compound features a heptane backbone with three methyl groups attached at the 2 and 4 positions, contributing to its branched structure. As a colorless liquid at room temperature, it is relatively non-polar and exhibits low solubility in water, while being soluble in organic solvents. 2,2,4-Trimethylheptane is stable under normal conditions but can participate in combustion reactions, producing carbon dioxide and water. Its physical properties include a moderate boiling point and a low vapor pressure, which are typical for larger alkanes. Due to its structure, it has a lower tendency to form soot during combustion compared to straight-chain alkanes, making it an efficient fuel. Additionally, it is used in research and as a reference standard in octane rating tests.
Formula:C10H22
InChI:InChI=1S/C10H22/c1-6-7-9(2)8-10(3,4)5/h9H,6-8H2,1-5H3
InChI key:InChIKey=IIYGOARYARWJBO-UHFFFAOYSA-N
SMILES:C(CC(C)(C)C)(CCC)C
Synonyms:- Heptane, 2,2,4-Trimethyl-
- 2,2,4-Trimethylheptane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Heptane, 2,2,4-trimethyl-
CAS:Formula:C10H22Purity:98%Color and Shape:LiquidMolecular weight:142.28172,2,4-Trimethylheptane
CAS:Controlled Product<p>Applications 2,2,4-Trimethylheptane is used as a component of jet fuels.<br>References Gordon, T. et al.: Atmos. Chem. Phys., 14, 4661 (2014);<br></p>Formula:C10H22Color and Shape:NeatMolecular weight:142.2822,2,4-Trimethylheptane
CAS:<p>2,2,4-Trimethylheptane is a volatile organic compound with a strong odor. It is used as a modeling or calibration standard for the analysis of other volatile compounds. The headspace technique can be used to extract 2,2,4-trimethylheptane from samples. Solid phase extraction can also be used to remove 2,2,4-trimethylheptane from samples. This compound has been found in the environment due to its presence in gasoline and cigarette smoke.</p>Formula:C10H22Purity:Min. 95%Molecular weight:142.28 g/mol





