CAS 14721-68-7
:2-Hydroxy-3,7,11,15-tetramethylhexadecanoic acid
Description:
2-Hydroxy-3,7,11,15-tetramethylhexadecanoic acid, also known as phytanic acid, is a branched-chain fatty acid characterized by its unique structure, which includes a hydroxyl group and multiple methyl groups. This compound is typically found in certain animal fats and is a product of the breakdown of chlorophyll in plants. Its molecular structure contributes to its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. Phytanic acid plays a significant role in human metabolism, particularly in the context of peroxisomal disorders, where its accumulation can lead to health issues. The presence of the hydroxyl group allows for potential interactions in biochemical pathways, while the branched structure influences its physical properties, such as melting point and viscosity. Additionally, phytanic acid is involved in various biological processes, including the synthesis of certain lipids and the regulation of cellular functions. Its CAS number, 14721-68-7, is used for identification in chemical databases and regulatory frameworks.
Formula:C20H40O3
InChI:InChI=1S/C20H40O3/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19(21)20(22)23/h15-19,21H,6-14H2,1-5H3,(H,22,23)
InChI key:InChIKey=CGKMKXBKVBXUGK-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)O)(CCCC(CCCC(CCCC(C)C)C)C)C
Synonyms:- 2-Hydroxy-3,7,11,15-tetramethylhexadecanoic acid
- Hexadecanoic acid, 2-hydroxy-3,7,11,15-tetramethyl-
- alpha-Hydroxyphytanic acid
- α-Hydroxyphytanic acid
- 2-Hydroxyphytanic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Hydroxy-3,7,11,15-tetramethylhexadecanoic acid
CAS:Formula:C20H40O3Purity:>98%Color and Shape:In solution, EthanolMolecular weight:328.532-Hydroxy-3,7,11,15-tetramethylhexadecanoic acid
CAS:2-Hydroxy-3,7,11,15-tetramethylhexadecanoic acid (2HMT) is a fatty acid that is formed by the oxidation of myristic and phytanic acids. 2HMT has been shown to be localized in human liver cells and to participate in peroxisomal β-oxidation. This fatty acid has been shown to be converted into other metabolites such as branched chain fatty acids. 2HMT can also be converted into α-hydroxylated metabolites or oxidized to form aldehydes.
Formula:C20H40O3Purity:Min. 95%Molecular weight:328.5 g/mol


