CAS 14722-38-4
:4-Methylcinnoline
Description:
4-Methylcinnoline is an organic compound characterized by its bicyclic structure, which includes a fused ring system comprising a pyridine and a pyrazole. It is a derivative of cinnoline, featuring a methyl group at the 4-position of the cinnoline ring. This compound is typically a yellow to brown solid and is known for its aromatic properties, contributing to its stability and potential reactivity. 4-Methylcinnoline is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anticancer properties. Its molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, it may exhibit fluorescence, which can be useful in analytical applications. As with many nitrogen-containing heterocycles, it is important to handle 4-Methylcinnoline with care, considering its potential toxicity and the need for proper safety protocols during experimentation.
Formula:C9H8N2
InChI:InChI=1S/C9H8N2/c1-7-6-10-11-9-5-3-2-4-8(7)9/h2-6H,1H3
InChI key:InChIKey=KREYIEXCOLYLAV-UHFFFAOYSA-N
SMILES:CC=1C2=C(N=NC1)C=CC=C2
Synonyms:- NSC 38294
- Cinnoline, 4-methyl-
- 4-Methylcinnoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
