CAS 147228-35-1
:(R)-3-AMINO-5,5-DIMETHYLHEXANOIC ACID
Description:
(R)-3-Amino-5,5-dimethylhexanoic acid, commonly referred to as a non-proteinogenic amino acid, is characterized by its unique structural features that include a branched-chain configuration. This compound contains an amino group (-NH2) and a carboxylic acid group (-COOH), which are typical functional groups found in amino acids. The presence of two methyl groups on the fifth carbon atom contributes to its branched structure, influencing its physical and chemical properties, such as solubility and reactivity. This amino acid is often studied for its potential applications in biochemistry and pharmaceuticals, particularly in the context of peptide synthesis and as a building block for various bioactive compounds. Its chirality, indicated by the (R) designation, suggests that it exists in a specific stereoisomeric form, which can affect its biological activity and interactions with enzymes and receptors. Overall, (R)-3-amino-5,5-dimethylhexanoic acid is a significant compound in the realm of organic chemistry and biochemistry, with implications for research and development in various scientific fields.
Formula:C8H17NO2
InChI:InChI=1/C8H17NO2/c1-8(2,3)5-6(9)4-7(10)11/h6H,4-5,9H2,1-3H3,(H,10,11)/t6-/m0/s1
SMILES:CC(C)(C)C[C@H](CC(=O)O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
