CAS 147290-11-7
:Fmoc-Orn(Aloc)-OH
Description:
Fmoc-Orn(Aloc)-OH, with the CAS number 147290-11-7, is a chemical compound that serves as a protected form of the amino acid ornithine. The Fmoc (9-fluorenylmethoxycarbonyl) group is a common protecting group used in peptide synthesis, allowing for selective reactions without interfering with other functional groups. The Aloc (allyloxycarbonyl) group is another protective moiety that can be removed under specific conditions, providing versatility in synthetic applications. This compound is typically utilized in the field of organic chemistry, particularly in the synthesis of peptides and other complex molecules. Its structure includes a primary amine, which is characteristic of amino acids, and the presence of both Fmoc and Aloc groups indicates that it can undergo various chemical transformations while maintaining stability. The compound is generally handled under standard laboratory conditions, and its reactivity can be influenced by the presence of other functional groups in a synthetic pathway. Overall, Fmoc-Orn(Aloc)-OH is a valuable intermediate in peptide chemistry, facilitating the construction of more complex biological molecules.
Formula:C24H26N2O6
InChI:InChI=1/C24H26N2O6/c1-2-14-31-23(29)25-13-7-12-21(22(27)28)26-24(30)32-15-20-18-10-5-3-8-16(18)17-9-4-6-11-19(17)20/h2-6,8-11,20-21H,1,7,12-15H2,(H,25,29)(H,26,30)(H,27,28)/t21-/m0/s1
SMILES:C=CCOC(=NCCC[C@@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12)O
Synonyms:- Fmoc-Orn(Alloc)-OH
- N~2~-[(9H-fluoren-9-ylmethoxy)carbonyl]-N~5~-[(prop-2-en-1-yloxy)carbonyl]-L-ornithine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Nδ-Allyloxycarbonyl-Nα-Fmoc-L-ornithine, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C24H26N2O6Purity:95%Molecular weight:438.48Fmoc-Orn(Aloc)-OH
CAS:<p>Bachem ID: 4026833.</p>Formula:C24H26N2O6Purity:99.5%Color and Shape:White PowderMolecular weight:438.49Fmoc-Orn(Alloc)-OH
CAS:Formula:C24H26N2O6Purity:≥ 98.0%Color and Shape:White or almost white powderMolecular weight:438.47(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-(((allyloxy)carbonyl)amino)pentanoic acid
CAS:(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-(((allyloxy)carbonyl)amino)pentanoic acidPurity:98%Molecular weight:438.47g/mol(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-(((allyloxy)carbonyl)amino)pentanoic acid
CAS:Purity:98%Color and Shape:SolidMolecular weight:438.480011N-α-Fmoc-Nδ-allyloxycarbonyl-L-ornithine
CAS:Please enquire for more information about N-alpha-Fmoc-Ndelta-allyloxycarbonyl-L-ornithine including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C24H26N2O6Purity:Min. 95%Molecular weight:438.47 g/mol






