CAS 147293-13-8

2-Amino-3-methyl-3H-imidazo[4,5-H]quinoline

Description:

2-Amino-3-methyl-3H-imidazo[4,5-H]quinoline is a heterocyclic organic compound characterized by its fused imidazole and quinoline rings, which contribute to its unique chemical properties. This compound typically exhibits a molecular structure that includes an amino group and a methyl group, influencing its reactivity and potential biological activity. It is known for its role in various biochemical processes and has been studied for its mutagenic properties, particularly in relation to its formation during the cooking of certain foods, such as grilled meats. The presence of the imidazoquinoline framework suggests potential interactions with biological macromolecules, making it of interest in medicinal chemistry and toxicology. Additionally, its solubility and stability can vary depending on environmental conditions, which may affect its behavior in biological systems. Overall, 2-Amino-3-methyl-3H-imidazo[4,5-H]quinoline is a compound of significant interest due to its structural characteristics and implications in health and safety.

Formula: C₁₁H₁₀N₄

InChI: InChI=1/C11H10N4/c1-15-8-5-4-7-3-2-6-13-9(7)10(8)14-11(15)12/h2-6H,1H3,(H2,12,14)

SMILES: Cn1c2ccc3cccnc3c2[nH]c1=N

Synonyms:

• 3H-Imidazo[4,5-h]quinolin-2-amine,3-methyl-(9CI)
• 3-methyl-3H-imidazo[4,5-h]quinolin-2-amine

2-Amino-3-methyl-3H-imidazo[4,5-h]quinoline

CAS: 147293-13-8

2-Amino-3-methyl-3H-imidazo[4,5-h]quinoline

Purity: ≥95%

Molecular weight: 198.22g/mol

Ref: 54-OR1675T

2-Amino-3-methyl-3H-imidazo[4,5-h]quinoline

Controlled Product

CAS: 147293-13-8

Applications A closely related isomer to the heterocyclic food mutagen IQ. Useful for biological and structure-activity studies of IQ.
References Jagerstad, M., et al.: Mutation Research, 144, 131 (1985), Vikse, R., et al.: Mutation Research, 319, 273 (1993)

Formula: C₁₁H₁₀N₄

Color and Shape: Neat

Molecular weight: 198.22

Ref: TR-A616750