CAS 147293-16-1

8-Nitro-7-methylaminoquinoline

Description:

8-Nitro-7-methylaminoquinoline is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of a nitro group at the 8-position and a methylamino group at the 7-position contributes to its unique reactivity and properties. This compound is typically a yellow to orange solid and is soluble in organic solvents, reflecting its aromatic nature. It may exhibit fluorescence, making it of interest in various applications, including as a potential fluorescent probe in biochemical assays. The nitro group can participate in electrophilic substitution reactions, while the amino group can act as a nucleophile, allowing for further chemical modifications. Additionally, 8-Nitro-7-methylaminoquinoline may have biological significance, as compounds with similar structures have been studied for their potential pharmacological activities. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with nitro-containing compounds.

Formula: C₁₀H₉N₃O₂

InChI: InChI=1/C10H9N3O2/c1-11-8-5-4-7-3-2-6-12-9(7)10(8)13(14)15/h2-6,11H,1H3

SMILES: CNc1ccc2cccnc2c1N(=O)=O

Synonyms:

• 7-Methylamino-8-nitroquinoline
• N-Methyl-8-nitro-7-quinolinamine

7-Quinolinamine, N-methyl-8-nitro-

CAS: 147293-16-1

Formula: C₁₀H₉N₃O₂

Color and Shape: Solid

Molecular weight: 203.1974

Ref: IN-DA001ERJ

8-Nitro-7-methylaminoquinoline

Controlled Product

CAS: 147293-16-1

Applications 8-Nitro-7-methylaminoquinoline (cas# 147293-16-1) is a compound useful in organic synthesis.

Formula: C₁₀H₉N₃O₂

Color and Shape: Neat

Molecular weight: 203.2

Ref: TR-N496580