CAS 1473-73-0
:2-Pyrazinecarboxamide, N-(4-morpholinylmethyl)-, hydrochloride (1:1)
Description:
2-Pyrazinecarboxamide, N-(4-morpholinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrazine and morpholine functional groups. It typically appears as a white to off-white crystalline solid and is soluble in water, which is common for many hydrochloride salts. The presence of the morpholine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound's structure indicates it may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological activities would depend on further empirical studies. The hydrochloride form enhances its stability and solubility, making it easier to handle in laboratory settings. As with many chemical substances, safety precautions should be observed when handling this compound, including the use of personal protective equipment, as it may pose health risks if ingested or inhaled. Overall, 2-Pyrazinecarboxamide, N-(4-morpholinylmethyl)-, hydrochloride is of interest in both synthetic and medicinal chemistry contexts.
Formula:C10H14N4O2·ClH
InChI:InChI=1S/C10H14N4O2.ClH/c15-10(9-7-11-1-2-12-9)13-8-14-3-5-16-6-4-14;/h1-2,7H,3-6,8H2,(H,13,15);1H
InChI key:InChIKey=CQTFUUAUHIMFAJ-UHFFFAOYSA-N
SMILES:C(NCN1CCOCC1)(=O)C=2C=NC=CN2.Cl
Synonyms:- 2-Pyrazinecarboxamide, N-(4-morpholinylmethyl)-, hydrochloride (1:1)
- B 2311
- Morinamide hydrochloride
- Morphazinamide HCl
- Morphazinamide hydrochloride
- N-(morpholin-4-ylmethyl)pyrazine-2-carboxamide hydrochloride (1:1)
- Piazofolina
- Pyrazinecarboxamide, N-(4-morpholinomethyl)-, monohydrochloride
- Pyrazinecarboxamide, N-(4-morpholinylmethyl)-, monohydrochloride
- Pyrazinecarboxamide, N-(morpholinomethyl)-, monohydrochloride
- N-(Morpholinomethyl)pyrazinecarboxamide monohydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Morinamide hydrochloride
CAS:<p>Morinamide hydrochloride is a synthetic antitubercular agent, which is derived from chemical synthesis processes. Its mode of action involves disrupting the synthesis of mycolic acids in the cell walls of Mycobacterium tuberculosis, thereby inhibiting bacterial growth and proliferation. The compound serves primarily as an antimicrobial agent targeting tuberculosis infections. In a laboratory setting, Morinamide hydrochloride is utilized in the study of bacterial resistance mechanisms and the development of novel therapeutic agents. Its specific action on mycolic acid synthesis makes it a valuable tool for researchers aiming to elucidate the pathways involved in mycobacterial cell wall construction and to develop more targeted chemotherapeutic interventions. Due to its crucial role, understanding the mechanisms and efficacy of Morinamide hydrochloride can greatly benefit scientific efforts in combating tuberculosis, especially in light of increasing drug resistance.</p>Formula:C10H15ClN4O2Purity:Min. 95%Molecular weight:258.7 g/mol


