CAS 14731-14-7: 2-bromo-1-(3-phenylisoxazol-5-yl)ethan-1-one

Description:2-bromo-1-(3-phenylisoxazol-5-yl)ethan-1-one, with the CAS number 14731-14-7, is an organic compound characterized by its unique structural features, including a bromine atom and an isoxazole ring. This compound typically exhibits a molecular structure that includes a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the phenyl group enhances its aromatic characteristics, which can influence its solubility and interaction with other chemical species. The isoxazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry. In terms of physical properties, it may display moderate to high polarity due to the functional groups present, affecting its behavior in various solvents. Additionally, the bromine substituent can impart specific reactivity patterns, making it a useful intermediate in the synthesis of more complex molecules. Overall, 2-bromo-1-(3-phenylisoxazol-5-yl)ethan-1-one is a compound with potential applications in pharmaceuticals and organic synthesis, warranting further investigation into its properties and reactivity.

Formula:C₁₁H₈BrNO₂

InChI:InChI=1/C11H8BrNO2/c12-7-10(14)11-6-9(13-15-11)8-4-2-1-3-5-8/h1-6H,7H2

Synonyms:
2-Bromo-1-(3-Phenylisoxazol-5-Yl)Ethanone

Found 4 products.

Product data	Purity	Price range	Estimated delivery
5-(Bromoacetyl)-3-phenylisoxazole REF: 10-F017227CAS: 14731-14-7	95.0%	67.00 €~367.00 €	Tue 15 Apr 25
Ethanone, 2-bromo-1-(3-phenyl-5-isoxazolyl)- REF: IN-DA001ESECAS: 14731-14-7	- - -	To inquire	Thu 17 Apr 25
5-(Bromoacetyl)-3-phenylisoxazole REF: 54-OR1268CAS: 14731-14-7	95%	42.00 €~309.00 €	Mon 21 Apr 25
5-(Bromoacetyl)-3-phenylisoxazole REF: 3D-PAA73114CAS: 14731-14-7	Min. 95%	To inquire	Thu 29 May 25