CAS 147333-13-9
:2-{[(1-{[1-(2-{[2-({[({1-[(1-{2-({2-amino-5-[(diaminomethylidene)amino]pentanoyl}amino)-5-[(diaminomethylidene)amino]pentanoyl}pyrrolidin-2-yl)carbonyl]-4-hydroxypyrrolidin-2-yl}carbonyl)amino]acetyl}amino)-3-phenylpropanoyl]amino}-3-hydroxypropanoyl)-4-(
Description:
The chemical substance with the name "2-{[(1-{[1-(2-{[2-({[({1-[(1-{2-({2-amino-5-[(diaminomethylidene)amino]pentanoyl}amino)-5-[(diaminomethylidene)amino]pentanoyl}pyrrolidin-2-yl)carbonyl]-4-hydroxypyrrolidin-2-yl}carbonyl)amino]acetyl}amino)-3-phenylpropanoyl]amino}-3-hydroxypropanoyl)-4-" and CAS number "147333-13-9" is a complex organic compound characterized by its intricate structure, which includes multiple amino acid residues and functional groups. This substance is likely to exhibit properties typical of peptides or peptide-like molecules, such as solubility in polar solvents, potential bioactivity, and the ability to form hydrogen bonds due to the presence of amino and hydroxyl groups. Its molecular structure suggests it may play a role in biological systems, possibly as a signaling molecule or in therapeutic applications. The presence of diaminomethylidene groups indicates potential reactivity, which could be relevant in drug design or biochemical interactions. Overall, the compound's complexity and functional diversity suggest it may have significant implications in medicinal chemistry or biochemistry.
Formula:C62H93N19O13S
InChI:InChI=1/C62H93N19O13S/c63-40(18-9-23-70-60(64)65)51(85)75-41(19-10-24-71-61(66)67)55(89)78-26-12-22-46(78)57(91)79-32-37(83)29-47(79)53(87)73-31-50(84)74-43(27-35-13-3-1-4-14-35)52(86)77-44(34-82)56(90)80-33-39(95-38-16-5-2-6-17-38)30-49(80)58(92)81-45-21-8-7-15-36(45)28-48(81)54(88)76-42(59(93)94)20-11-25-72-62(68)69/h1-6,13-14,16-17,36-37,39-49,82-83H,7-12,15,18-34,63H2,(H,73,87)(H,74,84)(H,75,85)(H,76,88)(H,77,86)(H,93,94)(H4,64,65,70)(H4,66,67,71)(H4,68,69,72)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
NPC 17761
CAS:NPC 17761 is a bradykinin receptor antagonist.Formula:C62H93N19O13SColor and Shape:SolidMolecular weight:1344.59
