CAS 147342-57-2
:3-PICOLYL ISOTHIOCYANATE HYDROBROMIDE
Description:
3-Picolyl isothiocyanate hydrobromide is a chemical compound characterized by its isothiocyanate functional group, which is known for its reactivity and potential biological activity. It is derived from 3-picoline, a pyridine derivative, and isothiocyanates, which are often associated with various pharmacological properties. The hydrobromide salt form indicates that it is combined with hydrobromic acid, enhancing its solubility in polar solvents, which is beneficial for various applications in organic synthesis and medicinal chemistry. This compound may exhibit properties such as antimicrobial or anticancer activity, making it of interest in pharmaceutical research. Additionally, isothiocyanates are known for their role in plant defense mechanisms and may have implications in food chemistry due to their presence in cruciferous vegetables. Safety data should be consulted, as isothiocyanates can be irritants and may pose health risks if not handled properly. Overall, 3-picolyl isothiocyanate hydrobromide represents a unique compound with potential applications in both research and industry.
Formula:C7H7BrN2S
InChI:InChI=1/C7H6N2S.BrH/c10-6-9-5-7-2-1-3-8-4-7;/h1-4H,5H2;1H
SMILES:c1cc(cnc1)CN=C=S.Br
Synonyms:- 3-(Isothiocyanatomethyl)pyridine hydrobromide (1:1)
- Pyridine, 3-(isothiocyanatomethyl)-, hydrobromide (1:1)
- 3-(Isothiocyanatomethyl)Pyridine Hydrobromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Picolyl isothiocyanate hydrobromide
CAS:3-Picolyl isothiocyanate hydrobromide
Molecular weight:231.11288g/mol

