CAS 147345-36-6
:4-bromo-4,4-difluorobutyric acid
Description:
4-Bromo-4,4-difluorobutyric acid is an organic compound characterized by the presence of a butyric acid backbone with specific halogen substitutions. The molecule features a bromine atom and two fluorine atoms attached to the fourth carbon of the butyric acid chain, which significantly influences its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its potential applications in pharmaceuticals and agrochemicals due to its unique reactivity and ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The presence of halogens often enhances the compound's lipophilicity and can affect its biological activity. Additionally, 4-bromo-4,4-difluorobutyric acid may exhibit specific solubility characteristics in organic solvents, making it useful in synthetic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C4H5BrF2O2
InChI:InChI=1/C4H5BrF2O2/c5-4(6,7)2-1-3(8)9/h1-2H2,(H,8,9)
SMILES:C(CC(Br)(F)F)C(=O)O
Synonyms:- 4-Bromo-4,4-Difluorobutanoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
