CymitQuimica logo

CAS 147374-04-7

:

ethyl 4-(3-bromophenyl)-4-oxo-butanoate

Description:
Ethyl 4-(3-bromophenyl)-4-oxo-butanoate is an organic compound characterized by its ester functional group and a ketone moiety. It features a butanoate backbone, with a bromophenyl substituent at the 4-position, which contributes to its unique chemical properties. The presence of the bromine atom enhances the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically a solid or liquid at room temperature, depending on its specific formulation and purity. Its molecular structure suggests it may exhibit moderate polarity due to the ester and ketone groups, influencing its solubility in organic solvents. Ethyl 4-(3-bromophenyl)-4-oxo-butanoate may also have applications in medicinal chemistry, particularly in the synthesis of biologically active molecules, due to the presence of the bromophenyl group, which can enhance biological activity or selectivity. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C12H13BrO3
InChI:InChI=1/C12H13BrO3/c1-2-16-12(15)7-6-11(14)9-4-3-5-10(13)8-9/h3-5,8H,2,6-7H2,1H3
InChI key:ZHFPTGNHPFQFGQ-UHFFFAOYSA-N
SMILES:CCOC(=O)CCC(=O)c1cccc(c1)Br
Found 2 products.