
CAS 147396-02-9
:Ligupurpuroside B
Description:
Ligupurpuroside B is a chemical compound classified as a saponin, which is a type of glycoside known for its surface-active properties. This compound is derived from various plant sources and is recognized for its potential biological activities, including anti-inflammatory and antioxidant effects. Ligupurpuroside B typically exhibits a complex structure characterized by a steroid or triterpenoid aglycone linked to one or more sugar moieties, which contribute to its solubility and reactivity. The presence of these sugar units often enhances its bioactivity and interaction with biological membranes. In research, saponins like Ligupurpuroside B are of interest for their potential therapeutic applications, including their role in modulating immune responses and their effects on cell signaling pathways. Additionally, the compound's unique structural features may influence its pharmacokinetics and bioavailability, making it a subject of study in natural product chemistry and pharmacology. Further investigation into Ligupurpuroside B could reveal more about its mechanisms of action and potential uses in medicine or health supplements.
Formula:C35H46O17
InChI:InChI=1S/C35H46O17/c1-16-24(40)25(41)27(43)34(47-16)51-30-17(2)48-35(28(44)26(30)42)52-32-29(45)33(46-14-13-19-5-10-21(38)11-6-19)49-22(15-36)31(32)50-23(39)12-7-18-3-8-20(37)9-4-18/h3-12,16-17,22,24-38,40-45H,13-15H2,1-2H3
InChI key:InChIKey=FNUMFJHHCJMAHD-UHFFFAOYSA-N
SMILES:O(C1C(OC(C=CC2=CC=C(O)C=C2)=O)C(CO)OC(OCCC3=CC=C(O)C=C3)C1O)C4C(O)C(O)C(OC5C(O)C(O)C(O)C(C)O5)C(C)O4
Synonyms:- (E)-Ligupurpuroside B
- Ligupurpuroside B
- b-D-Glucopyranoside,2-(4-hydroxyphenyl)ethyl O-6-deoxy-a-L-mannopyranosyl-(1® 4)-O-6-deoxy-a-L-mannopyranosyl-(1® 3)-, 4-[3-(4-hydroxyphenyl)-2-propenoate], (E)-
- trans-Ligupurpuroside B
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, 2-(4-hydroxyphenyl)ethyl O-6-deoxy-α-<smallcap>L</smallcap>-mannopyranosyl-(1→4)-O-6-deoxy-α-<smallcap>L</span>-mannopyranosyl-(1→3)-, 4-[(2E)-3-(4-hydroxyphenyl)-2-propenoate]
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, 2-(4-hydroxyphenyl)ethyl O-6-deoxy-α-<smallcap>L</smallcap>-mannopyranosyl-(1→4)-O-6-deoxy-α-<smallcap>L</span>-mannopyranosyl-(1→3)-, 4-[3-(4-hydroxyphenyl)-2-propenoate], (E)-
- β-D-Glucopyranoside, 2-(4-hydroxyphenyl)ethyl O-6-deoxy-α-L-mannopyranosyl-(1→4)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[3-(4-hydroxyphenyl)-2-propenoate], (E)-
- β-D-Glucopyranoside, 2-(4-hydroxyphenyl)ethyl O-6-deoxy-α-L-mannopyranosyl-(1→4)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(4-hydroxyphenyl)-2-propenoate]
Sort by
Found 4 products.
Ref: BP-BP0860
5mg326.00€10mg557.00€20mg909.00€Ligupurpuroside B
CAS:Ligupurpuroside B is a bioactive natural compound, which is isolated from the plant Ligularia purpurea. This compound is part of the sesquiterpene lactones family, known for their diverse biological activities. It exerts its mode of action by interacting with cellular pathways, potentially inhibiting specific enzymes or modulating signaling cascades, which can lead to various therapeutic effects.Formula:C35H46O17Purity:Min. 95%Molecular weight:738.7 g/molRef: 3D-XFA39602
10mg835.00€25mg1,283.00€50mg1,998.00€Ref: 7W-GY4881
neTo inquireLigupurpuroside B
CAS:Ligupurpuroside B has antioxidant activity.Formula:C35H46O17Purity:98%Color and Shape:SolidMolecular weight:738.736Ref: TM-TN1869
10mg598.00€