CAS 147396-07-4

Ethanone, 1-benzo[b]thien-2-yl-, oxime, (E)-

Description:

Ethanone, 1-benzo[b]thien-2-yl-, oxime, (E)-, is an organic compound characterized by its oxime functional group, which is derived from the reaction of ethanone with a benzo[b]thien-2-yl moiety. This compound features a double bond configuration (E), indicating that the higher priority substituents on either side of the double bond are on opposite sides, which influences its stereochemistry and potentially its reactivity. The presence of the benzo[b]thienyl group suggests that the compound may exhibit aromatic characteristics, contributing to its stability and potential interactions in various chemical environments. The oxime functional group is known for its ability to form stable complexes with metal ions and can participate in various chemical reactions, including condensation and rearrangement reactions. This compound may find applications in organic synthesis, medicinal chemistry, or as an intermediate in the production of other chemical entities. Its specific properties, such as solubility, melting point, and reactivity, would depend on the surrounding conditions and the presence of other functional groups.

Formula: C₁₀H₉NOS

InChI: InChI=1S/C10H9NOS/c1-7(11-12)10-6-8-4-2-3-5-9(8)13-10/h2-6,12H,1H3/b11-7+

InChI key: InChIKey=LYNWDHNMGAKITE-YRNVUSSQSA-N

SMILES: C(=N\O)(\C)/C1=CC=2C(S1)=CC=CC2

Synonyms:

• Ethanone, 1-benzo[b]thien-2-yl-, oxime, (E)-

(E)-1-(Benzo[b]​thiophen-​2-​yl)ethanone Oxime

Controlled Product

CAS: 147396-07-4

Applications (E)-1-(Benzo[b]​thiophen-​2-​yl)ethanone Oxime is an isomer of N-​(1-​Benzo[b]​thiophen-​2-​yl-​ethyl)​-​hydroxylamine a reagent used in the preparation of Zileuton, an anti-asthmatic drug.
References Guinchard, X. et al.: J. Org. Chem., 73, 2028 (2008)

Formula: C₁₀H₉NOS

Color and Shape: Neat

Molecular weight: 191.25

Ref: TR-B276763

(E)-1-(benzo[b]thiophen-2-yl)ethanone oxime

CAS: 147396-07-4

Formula: C₁₀H₉NOS

Molecular weight: 191.25

Ref: ST-EA-CP-Z9011