CAS 14741-71-0: (1H-BENZOIMIDAZOL-2-YL)-ACETIC ACID ETHYL ESTER
Description:(1H-Benzoimidazol-2-yl)-acetic acid ethyl ester, with the CAS number 14741-71-0, is a chemical compound characterized by its benzoimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, reflecting its hydrophobic nature due to the aromatic system. It may possess biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. The presence of the ethyl ester functional group suggests potential reactivity, allowing for hydrolysis to yield the corresponding acid, which may further influence its biological properties. Additionally, the compound's structure may confer specific interactions with biological targets, contributing to its pharmacological profile. Overall, (1H-benzimidazol-2-yl)-acetic acid ethyl ester is a compound of interest in medicinal chemistry, with potential applications in drug development and therapeutic interventions.
Formula:C11H12N2O2
InChI:InChI=1/C11H12N2O2/c1-2-15-11(14)7-10-12-8-5-3-4-6-9(8)13-10/h3-6H,2,7H2,1H3,(H,12,13)
- Synonyms:
- 1H-Benzimidazole-2-acetic acid, ethyl ester
- Ethyl 1H-benzimidazol-2-ylacetate
- (1H-Benzoimidazol-2-yl)-acetic acid ethyl ester
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1H-Benzimidazole-2-acetic acid, ethyl ester REF: IN-DA001EW0CAS: 14741-71-0 | 98% | 25.00 €~468.00 € | Fri 28 Mar 25 |
 | (1H-Benzoimidazol-2-yl)-acetic acid ethyl ester REF: 54-OR89986CAS: 14741-71-0 | 95% | 259.00 €~963.00 € | Mon 31 Mar 25 |
 | Ethyl (2-benzoimidazolyl)acetate REF: 10-F049985CAS: 14741-71-0 | 95.0% | 23.00 €~401.00 € | Mon 31 Mar 25 |
 | Ethyl 1H-benzimidazol-2-ylacetate REF: 3D-FE135915CAS: 14741-71-0 | Min. 95% | - - - | Discontinued product |
1H-Benzimidazole-2-acetic acid, ethyl ester
Ref: IN-DA001EW0
| 1g | 47.00 € | ||
| 5g | 105.00 € | ||
| 10g | 145.00 € | ||
| 25g | 468.00 € | ||
| 100mg | 25.00 € | ||
| 250mg | 34.00 € |
Ethyl (2-benzoimidazolyl)acetate
Ref: 10-F049985
| 1g | 23.00 € | ||
| 5g | 98.00 € | ||
| 25g | 401.00 € |
Ethyl 1H-benzimidazol-2-ylacetate
Ref: 3D-FE135915
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
