CAS 14742-32-6
:2-AMINO-5-PHENYL-3-FURONITRILE
Description:
2-Amino-5-phenyl-3-furonitrile, with the CAS number 14742-32-6, is an organic compound characterized by the presence of both an amino group and a nitrile functional group attached to a furan ring. This compound typically exhibits a pale to light yellow crystalline appearance. Its molecular structure includes a phenyl group, which contributes to its aromatic properties and potential reactivity. The amino group can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. The furan ring provides a heterocyclic framework that can engage in various chemical reactions, including electrophilic substitution. This compound may be of interest in pharmaceutical and agrochemical research due to its potential biological activity. Additionally, its nitrile group can serve as a versatile functional group in organic synthesis, allowing for further derivatization. Overall, 2-amino-5-phenyl-3-furonitrile is a compound with diverse chemical properties that can be explored for various applications in organic chemistry and material science.
Formula:C11H8N2O
InChI:InChI=1/C11H8N2O/c12-7-9-6-10(14-11(9)13)8-4-2-1-3-5-8/h1-6H,13H2
SMILES:c1ccc(cc1)c1cc(C#N)c(N)o1
Synonyms:- Akos Ussh-4110757
- 2-Amino-5-Phenyl-Furan-3-Carbonitrile
- 2-Amino-3-Cyano-5-Phenylfuran
- Aurora 20110
- Buttpark 46\12-26
- Timtec-Bb Sbb005514
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-5-phenyl-3-furonitrile
CAS:2-Amino-5-phenyl-3-furonitrilePurity:95%Color and Shape:SolidMolecular weight:184.19g/mol2-Amino-5-phenyl-3-furonitrile
CAS:2-Amino-5-phenyl-3-furonitrile is a heterocyclic compound that belongs to the group of pyrimidine derivatives. It can be prepared by the reaction of 2,4,6-trichloropyrimidine with phenylacetonitrile and sodium hydroxide in water. This synthesis gives high yields of 2-amino-5-phenyl-3-furonitrile. The compound reacts with isothiocyanates to form heterocyclic compounds. The process of catalyzed heterocyclization has been shown to be effective for the synthesis of pyrimidine derivatives.Formula:C11H8N2OPurity:Min. 95%Molecular weight:184.19 g/mol



