CAS 147459-51-6
:(R,R)-2,8-Diazabicyclo[4,3,0]Nonane
Description:
(R,R)-2,8-Diazabicyclo[4,3,0]nonane, with CAS number 147459-51-6, is a bicyclic organic compound characterized by its unique structure that features two nitrogen atoms incorporated into a bicyclic framework. This compound is a member of the diazabicycloalkane family, which is known for its potential applications in organic synthesis and catalysis. The (R,R) designation indicates that the compound has specific stereochemistry, which can influence its reactivity and interaction with other molecules. Typically, diazabicyclo compounds exhibit basic properties due to the presence of nitrogen atoms, which can act as proton acceptors. This compound may also participate in various chemical reactions, including those involving nucleophilic attack or coordination with metal ions. Its structural features contribute to its potential utility in asymmetric synthesis and as a ligand in coordination chemistry. Overall, (R,R)-2,8-Diazabicyclo[4,3,0]nonane is of interest in both academic research and industrial applications due to its distinctive properties and reactivity.
Formula:C7H14N2
InChI:InChI=1/C7H14N2/c1-2-6-4-8-5-7(6)9-3-1/h6-9H,1-5H2/t6-,7+/m1/s1
Synonyms:- (4aR,7aR)-octahydro-1H-pyrrolo[3,4-b]pyridine
- cis-Octahydro-1H-pyrrolo[3,4-b]pyridine
- (4aR,7aR)-rel-Octahydro-1H-pyrrolo[3,4-b]pyridine
- Moxifloxacin Impurity H
- 1H-Pyrrolo[3,4-b]pyridine,octahydro-, (4aR,7aR)-rel-
- Moxifloxacin side chain enantiomer
- (4R,7R)-Moxifloxacin Side chain
- 147459-51-6
- (R,R)-2,8-diazobicyclo[4,3,0]-nonane
- Moxifloxacin Impurity 3, cis-Octahydropyrrolo[3,4-b]pyridine
- Moxifloxacin EP Impurity H
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
cis-Octahydropyrrolo[3,4-b]pyridine
CAS:Formula:C7H14N2Purity:96%Color and Shape:LiquidMolecular weight:126.1995cis-Octahydro-1H-pyrrolo[3,4-b]pyridine
CAS:cis-Octahydro-1H-pyrrolo[3,4-b]pyridinePurity:96%Molecular weight:126.2g/mol(R,R)-2,8-Diazabicyclo[4.3.0]nonane
CAS:(R,R)-2,8-Diazabicyclo[4.3.0]nonane is an antibacterial agent that is synthesized from piperazine and fluoroquinolone derivatives. It has a high yield of (R,R)-2,8-diazabicyclo[4.3.0]nonane and a low reaction time in the microwave amination reaction. This compound can be used to replace environmentally hazardous chemicals such as mercury(II) chloride in the synthesis of (R,R)-2,8-diazabicyclo[4.3.0]nonane by avoiding the use of toxic mercury compounds and reducing the cost of production by using microwave irradiation.Formula:C7H14N2Purity:Min. 95%Color and Shape:PowderMolecular weight:126.2 g/molcis-Octahydropyrrolo[3,4-b]pyridine
CAS:Formula:C7H14N2Purity:96%Color and Shape:Liquid, Brown liquidMolecular weight:126.203cis-Octahydropyrrolo[3,4-b]pyridine
CAS:Controlled ProductApplications cis-Octahydropyrrolo[3,4-b]pyridine is a useful intermediate for the synthesis of moxifloxacin, a drug for the treatment of bacterial infection.
References Liu, M., et al.: Zhongguo Yiyao Gongye Zazhi, 35, 129 (2004)Formula:C7H14N2Color and Shape:NeatMolecular weight:126.2





